C23H24ClN3O3 — CID 16889576
3-(2-chlorophenyl)-5-methyl-N-[2-(4-morpholin-4-ylphenyl)ethyl]-1,2-oxazole-4-carboxamide (PubChem CID 16889576) has the molecular formula C23H24ClN3O3 and a molecular weight of 425.92 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-5-methyl-N-[2-(4-morpholin-4-ylphenyl)ethyl]-1,2-oxazole-4-carboxamide.
| Compound Name | 3-(2-chlorophenyl)-5-methyl-N-[2-(4-morpholin-4-ylphenyl)ethyl]-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 16889576 |
| Molecular Formula | C23H24ClN3O3 |
| Molecular Weight | 425.92 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | 3-(2-chlorophenyl)-5-methyl-N-[2-(4-morpholin-4-ylphenyl)ethyl]-1,2-oxazole-4-carboxamide |
| SMILES | Cc1onc(-c2ccccc2Cl)c1C(=O)NCCc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C23H24ClN3O3/c1-16-21(22(26-30-16)19-4-2-3-5-20(19)24)23(28)25-11-10-17-6-8-18(9-7-17)27-12-14-29-15-13-27/h2-9H,10-15H2,1H3,(H,25,28) |
| InChIKey | VBPLXUKMKAVGFR-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.92 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|