C11H18F3N — CID 168895764
1,5,7-trifluoro-3,7-dimethylbicyclo[3.3.1]nonan-3-amine (PubChem CID 168895764) has the molecular formula C11H18F3N and a molecular weight of 221.27 g/mol. Its IUPAC name is 1,5,7-trifluoro-3,7-dimethylbicyclo[3.3.1]nonan-3-amine.
| Compound Name | 1,5,7-trifluoro-3,7-dimethylbicyclo[3.3.1]nonan-3-amine |
|---|---|
| PubChem CID | 168895764 |
| Molecular Formula | C11H18F3N |
| Molecular Weight | 221.27 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 1,5,7-trifluoro-3,7-dimethylbicyclo[3.3.1]nonan-3-amine |
| SMILES | CC1(N)CC2(F)CC(C)(F)CC(F)(C1)C2 |
| InChI | InChI=1S/C11H18F3N/c1-8(12)3-10(13)5-9(2,15)6-11(14,4-8)7-10/h3-7,15H2,1-2H3 |
| InChIKey | VFUPIUIPFJKYFM-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.27 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |