C14H15Cl2N3O7 — CID 168895904
[(2R,3S,4R,5R)-5-azido-2,3,4-trihydroxy-6-oxohexyl] 3,6-dichloro-2-methoxybenzoate (PubChem CID 168895904) has the molecular formula C14H15Cl2N3O7 and a molecular weight of 408.19 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-azido-2,3,4-trihydroxy-6-oxohexyl] 3,6-dichloro-2-methoxybenzoate.
| Compound Name | [(2R,3S,4R,5R)-5-azido-2,3,4-trihydroxy-6-oxohexyl] 3,6-dichloro-2-methoxybenzoate |
|---|---|
| PubChem CID | 168895904 |
| Molecular Formula | C14H15Cl2N3O7 |
| Molecular Weight | 408.19 g/mol |
| Exact Mass | 407.03 |
| IUPAC Name | [(2R,3S,4R,5R)-5-azido-2,3,4-trihydroxy-6-oxohexyl] 3,6-dichloro-2-methoxybenzoate |
| SMILES | COc1c(Cl)ccc(Cl)c1C(=O)OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](C=O)N=[N+]=[N-] |
| InChI | InChI=1S/C14H15Cl2N3O7/c1-25-13-7(16)3-2-6(15)10(13)14(24)26-5-9(21)12(23)11(22)8(4-20)18-19-17/h2-4,8-9,11-12,21-23H,5H2,1H3/t8-,9+,11+,12+/m0/s1 |
| InChIKey | QJSLERQBVQIPLJ-LUTQBAROSA-N |
| XLogP | 1.12 |
| TPSA | 162.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.19 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|