C14H16Cl2O7 — CID 168895934
[(3S,6S)-3,4,6-trihydroxyoxan-2-yl]methyl 3,6-dichloro-2-methoxybenzoate (PubChem CID 168895934) has the molecular formula C14H16Cl2O7 and a molecular weight of 367.18 g/mol. Its IUPAC name is [(3S,6S)-3,4,6-trihydroxyoxan-2-yl]methyl 3,6-dichloro-2-methoxybenzoate.
| Compound Name | [(3S,6S)-3,4,6-trihydroxyoxan-2-yl]methyl 3,6-dichloro-2-methoxybenzoate |
|---|---|
| PubChem CID | 168895934 |
| Molecular Formula | C14H16Cl2O7 |
| Molecular Weight | 367.18 g/mol |
| Exact Mass | 366.03 |
| IUPAC Name | [(3S,6S)-3,4,6-trihydroxyoxan-2-yl]methyl 3,6-dichloro-2-methoxybenzoate |
| SMILES | COc1c(Cl)ccc(Cl)c1C(=O)OCC1O[C@H](O)CC(O)[C@@H]1O |
| InChI | InChI=1S/C14H16Cl2O7/c1-21-13-7(16)3-2-6(15)11(13)14(20)22-5-9-12(19)8(17)4-10(18)23-9/h2-3,8-10,12,17-19H,4-5H2,1H3/t8?,9?,10-,12-/m0/s1 |
| InChIKey | FRTZSQZKETZTFA-GZJRGEOXSA-N |
| XLogP | 0.99 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.18 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |