C14H16Cl2O8 — CID 168895942
[(2S,3S,4R,5S)-2,3,4,5-tetrahydroxyoxan-2-yl]methyl 3,6-dichloro-2-methoxybenzoate (PubChem CID 168895942) has the molecular formula C14H16Cl2O8 and a molecular weight of 383.18 g/mol. Its IUPAC name is [(2S,3S,4R,5S)-2,3,4,5-tetrahydroxyoxan-2-yl]methyl 3,6-dichloro-2-methoxybenzoate.
| Compound Name | [(2S,3S,4R,5S)-2,3,4,5-tetrahydroxyoxan-2-yl]methyl 3,6-dichloro-2-methoxybenzoate |
|---|---|
| PubChem CID | 168895942 |
| Molecular Formula | C14H16Cl2O8 |
| Molecular Weight | 383.18 g/mol |
| Exact Mass | 382.02 |
| IUPAC Name | [(2S,3S,4R,5S)-2,3,4,5-tetrahydroxyoxan-2-yl]methyl 3,6-dichloro-2-methoxybenzoate |
| SMILES | COc1c(Cl)ccc(Cl)c1C(=O)OC[C@]1(O)OC[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C14H16Cl2O8/c1-22-11-7(16)3-2-6(15)9(11)13(20)23-5-14(21)12(19)10(18)8(17)4-24-14/h2-3,8,10,12,17-19,21H,4-5H2,1H3/t8-,10+,12-,14-/m0/s1 |
| InChIKey | DNKPMPQKRJUAKD-ZQYILIGKSA-N |
| XLogP | -0.04 |
| TPSA | 125.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.18 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |