C44H29N3 — CID 168897078
5,12,18-tris(4-methylphenyl)pentacyclo[6.6.6.02,7.09,14.015,20]icosa-2(7),3,5,9(14),10,12,15(20),16,18-nonaene-4,11,17-tricarbonitrile (PubChem CID 168897078) has the molecular formula C44H29N3 and a molecular weight of 599.74 g/mol. Its IUPAC name is 5,12,18-tris(4-methylphenyl)pentacyclo[6.6.6.02,7.09,14.015,20]icosa-2(7),3,5,9(14),10,12,15(20),16,18-nonaene-4,11,17-tricarbonitrile.
| Compound Name | 5,12,18-tris(4-methylphenyl)pentacyclo[6.6.6.02,7.09,14.015,20]icosa-2(7),3,5,9(14),10,12,15(20),16,18-nonaene-4,11,17-tricarbonitrile |
|---|---|
| PubChem CID | 168897078 |
| Molecular Formula | C44H29N3 |
| Molecular Weight | 599.74 g/mol |
| Exact Mass | 599.24 |
| IUPAC Name | 5,12,18-tris(4-methylphenyl)pentacyclo[6.6.6.02,7.09,14.015,20]icosa-2(7),3,5,9(14),10,12,15(20),16,18-nonaene-4,11,17-tricarbonitrile |
| SMILES | Cc1ccc(-c2cc3c(cc2C#N)C2c4cc(-c5ccc(C)cc5)c(C#N)cc4C3c3cc(C#N)c(-c4ccc(C)cc4)cc32)cc1 |
| InChI | InChI=1S/C44H29N3/c1-25-4-10-28(11-5-25)34-19-40-39(18-33(34)24-47)44-41-20-35(29-12-6-26(2)7-13-29)31(22-45)16-37(41)43(40)38-17-32(23-46)36(21-42(38)44)30-14-8-27(3)9-15-30/h4-21,43-44H,1-3H3 |
| InChIKey | NJRVTYLLHJENRU-UHFFFAOYSA-N |
| XLogP | 10.22 |
| TPSA | 71.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.74 |
| LogP ≤ 5 | 10.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |