About (3-methyl-1,1-dioxo-2,5-dihydrothiophen-2-yl)methyl acetate
(3-methyl-1,1-dioxo-2,5-dihydrothiophen-2-yl)methyl acetate (PubChem CID 168897156) has the molecular formula C8H12O4S
and a molecular weight of 204.25 g/mol. Its IUPAC name is (3-methyl-1,1-dioxo-2,5-dihydrothiophen-2-yl)methyl acetate.
Molecular Properties
| Compound Name | (3-methyl-1,1-dioxo-2,5-dihydrothiophen-2-yl)methyl acetate |
| PubChem CID | 168897156 |
| Molecular Formula | C8H12O4S |
| Molecular Weight | 204.25 g/mol |
| Exact Mass | 204.05 |
| IUPAC Name | (3-methyl-1,1-dioxo-2,5-dihydrothiophen-2-yl)methyl acetate |
| SMILES | CC(=O)OCC1C(C)=CCS1(=O)=O |
| InChI | InChI=1S/C8H12O4S/c1-6-3-4-13(10,11)8(6)5-12-7(2)9/h3,8H,4-5H2,1-2H3 |
| InChIKey | KZANULKOGBKJML-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.25 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3-methyl-1,1-dioxo-2,5-dihydrothiophen-2-yl)methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methyl-1,1-dioxo-2,5-dihydrothiophen-2-yl)methyl acetate?
The IUPAC name of (3-methyl-1,1-dioxo-2,5-dihydrothiophen-2-yl)methyl acetate (CID 168897156) is (3-methyl-1,1-dioxo-2,5-dihydrothiophen-2-yl)methyl acetate.
What is the SMILES notation for (3-methyl-1,1-dioxo-2,5-dihydrothiophen-2-yl)methyl acetate?
The canonical SMILES for (3-methyl-1,1-dioxo-2,5-dihydrothiophen-2-yl)methyl acetate is CC(=O)OCC1C(C)=CCS1(=O)=O.
What is the InChIKey of (3-methyl-1,1-dioxo-2,5-dihydrothiophen-2-yl)methyl acetate?
The InChIKey is KZANULKOGBKJML-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O4S/c1-6-3-4-13(10,11)8(6)5-12-7(2)9/h3,8H,4-5H2,1-2H3.
What are the key properties of (3-methyl-1,1-dioxo-2,5-dihydrothiophen-2-yl)methyl acetate?
(3-methyl-1,1-dioxo-2,5-dihydrothiophen-2-yl)methyl acetate has a molecular weight of 204.25 g/mol, XLogP of 0.29, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methyl-1,1-dioxo-2,5-dihydrothiophen-2-yl)methyl acetate is sourced from PubChem (CID 168897156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).