C36H49N5O3 — CID 168897266
3-[(2S,3S)-13-ethyl-8-(hydroxymethyl)-3,7,12,12,17,20-hexamethyl-3,13,22,24-tetrahydro-2H-porphyrin-2-yl]-N-(2-methoxyethyl)-N-methylpropanamide (PubChem CID 168897266) has the molecular formula C36H49N5O3 and a molecular weight of 599.82 g/mol. Its IUPAC name is 3-[(2S,3S)-13-ethyl-8-(hydroxymethyl)-3,7,12,12,17,20-hexamethyl-3,13,22,24-tetrahydro-2H-porphyrin-2-yl]-N-(2-methoxyethyl)-N-methylpropanamide.
| Compound Name | 3-[(2S,3S)-13-ethyl-8-(hydroxymethyl)-3,7,12,12,17,20-hexamethyl-3,13,22,24-tetrahydro-2H-porphyrin-2-yl]-N-(2-methoxyethyl)-N-methylpropanamide |
|---|---|
| PubChem CID | 168897266 |
| Molecular Formula | C36H49N5O3 |
| Molecular Weight | 599.82 g/mol |
| Exact Mass | 599.38 |
| IUPAC Name | 3-[(2S,3S)-13-ethyl-8-(hydroxymethyl)-3,7,12,12,17,20-hexamethyl-3,13,22,24-tetrahydro-2H-porphyrin-2-yl]-N-(2-methoxyethyl)-N-methylpropanamide |
| SMILES | CCC1c2cc3[nH]c(cc3C)c(C)c3nc(cc4[nH]c(cc(n2)C1(C)C)c(CO)c4C)[C@@H](C)[C@@H]3CCC(=O)N(C)CCOC |
| InChI | InChI=1S/C36H49N5O3/c1-10-26-32-16-27-20(2)15-28(37-27)23(5)35-24(11-12-34(43)41(8)13-14-44-9)21(3)30(40-35)17-29-22(4)25(19-42)31(38-29)18-33(39-32)36(26,6)7/h15-18,21,24,26,37-38,42H,10-14,19H2,1-9H3/b27-16-,28-23-,29-17-,30-17-,31-18-,32-16-,33-18-,35-23-/t21-,24-,26?/m0/s1 |
| InChIKey | NQAWOEJRZHKLOI-PVBCZHRFSA-N |
| XLogP | 6.98 |
| TPSA | 107.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.82 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |