C40H52N4O6S — CID 168897486
methyl 7-ethyl-12-[1-[3-[4-hydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylpropoxy]ethyl]-3,8,13,17,20-pentamethyl-17,18,22,23-tetrahydroporphyrin-2-carboxylate (PubChem CID 168897486) has the molecular formula C40H52N4O6S and a molecular weight of 716.94 g/mol. Its IUPAC name is methyl 7-ethyl-12-[1-[3-[4-hydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylpropoxy]ethyl]-3,8,13,17,20-pentamethyl-17,18,22,23-tetrahydroporphyrin-2-carboxylate.
| Compound Name | methyl 7-ethyl-12-[1-[3-[4-hydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylpropoxy]ethyl]-3,8,13,17,20-pentamethyl-17,18,22,23-tetrahydroporphyrin-2-carboxylate |
|---|---|
| PubChem CID | 168897486 |
| Molecular Formula | C40H52N4O6S |
| Molecular Weight | 716.94 g/mol |
| Exact Mass | 716.36 |
| IUPAC Name | methyl 7-ethyl-12-[1-[3-[4-hydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylpropoxy]ethyl]-3,8,13,17,20-pentamethyl-17,18,22,23-tetrahydroporphyrin-2-carboxylate |
| SMILES | CCc1c(C)c2cc3[nH]c(cc4nc(c(C)c5nc(cc1[nH]2)C(C)=C5C(=O)OC)CC4C)c(C)c3C(C)OCCCSC1CC(O)CC(CO)O1 |
| InChI | InChI=1S/C40H52N4O6S/c1-9-28-21(3)31-18-35-37(25(7)49-11-10-12-51-36-15-26(46)14-27(19-45)50-36)22(4)32(43-35)16-29-20(2)13-30(41-29)24(6)39-38(40(47)48-8)23(5)33(44-39)17-34(28)42-31/h16-18,20,25-27,36,42-43,45-46H,9-15,19H2,1-8H3/b29-16-,30-24-,31-18-,32-16-,33-17-,34-17-,35-18-,39-24- |
| InChIKey | HSNGKYFGDKWZSW-HQUWJRFJSA-N |
| XLogP | 7.31 |
| TPSA | 142.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.94 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|