C32H39N5 — CID 168897582
3-[(2S,3S)-8-ethenyl-13-ethyl-3,7,12,17,20-pentamethyl-2,3,22,23-tetrahydroporphyrin-2-yl]propan-1-amine (PubChem CID 168897582) has the molecular formula C32H39N5 and a molecular weight of 493.70 g/mol. Its IUPAC name is 3-[(2S,3S)-8-ethenyl-13-ethyl-3,7,12,17,20-pentamethyl-2,3,22,23-tetrahydroporphyrin-2-yl]propan-1-amine.
| Compound Name | 3-[(2S,3S)-8-ethenyl-13-ethyl-3,7,12,17,20-pentamethyl-2,3,22,23-tetrahydroporphyrin-2-yl]propan-1-amine |
|---|---|
| PubChem CID | 168897582 |
| Molecular Formula | C32H39N5 |
| Molecular Weight | 493.70 g/mol |
| Exact Mass | 493.32 |
| IUPAC Name | 3-[(2S,3S)-8-ethenyl-13-ethyl-3,7,12,17,20-pentamethyl-2,3,22,23-tetrahydroporphyrin-2-yl]propan-1-amine |
| SMILES | C=Cc1c(C)c2cc3nc(c(C)c4nc(cc5[nH]c(cc1[nH]2)c(C)c5CC)C(C)=C4)[C@@H](CCCN)[C@@H]3C |
| InChI | InChI=1S/C32H39N5/c1-8-22-19(5)28-16-31-23(9-2)18(4)27(35-31)15-29-20(6)24(11-10-12-33)32(37-29)21(7)26-13-17(3)25(34-26)14-30(22)36-28/h9,13-16,20,24,35-36H,2,8,10-12,33H2,1,3-7H3/b25-14-,26-21-,27-15-,28-16-,29-15-,30-14-,31-16-,32-21-/t20-,24-/m0/s1 |
| InChIKey | MNUKXNJLTSHSLZ-DXFHMFOXSA-N |
| XLogP | 7.63 |
| TPSA | 83.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.70 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |