C21H21F7N2OS — CID 168898169
ethane;2,2,2-trifluoro-1-[7-[[2,2,2-trifluoro-1-(4-fluorophenyl)ethyl]amino]sulfanyl-3,4-dihydro-1H-isoquinolin-2-yl]ethanone (PubChem CID 168898169) has the molecular formula C21H21F7N2OS and a molecular weight of 482.47 g/mol. Its IUPAC name is ethane;2,2,2-trifluoro-1-[7-[[2,2,2-trifluoro-1-(4-fluorophenyl)ethyl]amino]sulfanyl-3,4-dihydro-1H-isoquinolin-2-yl]ethanone.
| Compound Name | ethane;2,2,2-trifluoro-1-[7-[[2,2,2-trifluoro-1-(4-fluorophenyl)ethyl]amino]sulfanyl-3,4-dihydro-1H-isoquinolin-2-yl]ethanone |
|---|---|
| PubChem CID | 168898169 |
| Molecular Formula | C21H21F7N2OS |
| Molecular Weight | 482.47 g/mol |
| Exact Mass | 482.13 |
| IUPAC Name | ethane;2,2,2-trifluoro-1-[7-[[2,2,2-trifluoro-1-(4-fluorophenyl)ethyl]amino]sulfanyl-3,4-dihydro-1H-isoquinolin-2-yl]ethanone |
| SMILES | CC.O=C(N1CCc2ccc(SNC(c3ccc(F)cc3)C(F)(F)F)cc2C1)C(F)(F)F |
| InChI | InChI=1S/C19H15F7N2OS.C2H6/c20-14-4-1-12(2-5-14)16(18(21,22)23)27-30-15-6-3-11-7-8-28(10-13(11)9-15)17(29)19(24,25)26;1-2/h1-6,9,16,27H,7-8,10H2;1-2H3 |
| InChIKey | IYOZGCQARCMKKI-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.47 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|