About ethane;N-ethenyl-6-ethyl-2-methylpyridazin-3-imine
ethane;N-ethenyl-6-ethyl-2-methylpyridazin-3-imine (PubChem CID 168898415) has the molecular formula C11H19N3
and a molecular weight of 193.29 g/mol. Its IUPAC name is ethane;N-ethenyl-6-ethyl-2-methylpyridazin-3-imine.
Molecular Properties
| Compound Name | ethane;N-ethenyl-6-ethyl-2-methylpyridazin-3-imine |
| PubChem CID | 168898415 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | ethane;N-ethenyl-6-ethyl-2-methylpyridazin-3-imine |
| SMILES | C=C/N=c1\ccc(CC)nn1C.CC |
| InChI | InChI=1S/C9H13N3.C2H6/c1-4-8-6-7-9(10-5-2)12(3)11-8;1-2/h5-7H,2,4H2,1,3H3;1-2H3/b10-9+; |
| InChIKey | DCCSIIIAEVLCRZ-RRABGKBLSA-N |
| XLogP | 2.05 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;N-ethenyl-6-ethyl-2-methylpyridazin-3-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-ethenyl-6-ethyl-2-methylpyridazin-3-imine?
The IUPAC name of ethane;N-ethenyl-6-ethyl-2-methylpyridazin-3-imine (CID 168898415) is ethane;N-ethenyl-6-ethyl-2-methylpyridazin-3-imine.
What is the SMILES notation for ethane;N-ethenyl-6-ethyl-2-methylpyridazin-3-imine?
The canonical SMILES for ethane;N-ethenyl-6-ethyl-2-methylpyridazin-3-imine is C=C/N=c1\ccc(CC)nn1C.CC.
What is the InChIKey of ethane;N-ethenyl-6-ethyl-2-methylpyridazin-3-imine?
The InChIKey is DCCSIIIAEVLCRZ-RRABGKBLSA-N. The full InChI is InChI=1S/C9H13N3.C2H6/c1-4-8-6-7-9(10-5-2)12(3)11-8;1-2/h5-7H,2,4H2,1,3H3;1-2H3/b10-9+;.
What are the key properties of ethane;N-ethenyl-6-ethyl-2-methylpyridazin-3-imine?
ethane;N-ethenyl-6-ethyl-2-methylpyridazin-3-imine has a molecular weight of 193.29 g/mol, XLogP of 2.05, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-ethenyl-6-ethyl-2-methylpyridazin-3-imine is sourced from PubChem (CID 168898415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).