About 4-[ethyl-[2,2,2-trifluoro-1-(4-fluorophenyl)ethyl]amino]sulfanylthiophene-2-carbonitrile
4-[ethyl-[2,2,2-trifluoro-1-(4-fluorophenyl)ethyl]amino]sulfanylthiophene-2-carbonitrile (PubChem CID 168898432) has the molecular formula C15H12F4N2S2
and a molecular weight of 360.40 g/mol. Its IUPAC name is 4-[ethyl-[2,2,2-trifluoro-1-(4-fluorophenyl)ethyl]amino]sulfanylthiophene-2-carbonitrile.
Molecular Properties
| Compound Name | 4-[ethyl-[2,2,2-trifluoro-1-(4-fluorophenyl)ethyl]amino]sulfanylthiophene-2-carbonitrile |
| PubChem CID | 168898432 |
| Molecular Formula | C15H12F4N2S2 |
| Molecular Weight | 360.40 g/mol |
| Exact Mass | 360.04 |
| IUPAC Name | 4-[ethyl-[2,2,2-trifluoro-1-(4-fluorophenyl)ethyl]amino]sulfanylthiophene-2-carbonitrile |
| SMILES | CCN(Sc1csc(C#N)c1)C(c1ccc(F)cc1)C(F)(F)F |
| InChI | InChI=1S/C15H12F4N2S2/c1-2-21(23-13-7-12(8-20)22-9-13)14(15(17,18)19)10-3-5-11(16)6-4-10/h3-7,9,14H,2H2,1H3 |
| InChIKey | HXFFPCKKFYWOAH-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 360.40 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[ethyl-[2,2,2-trifluoro-1-(4-fluorophenyl)ethyl]amino]sulfanylthiophene-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[ethyl-[2,2,2-trifluoro-1-(4-fluorophenyl)ethyl]amino]sulfanylthiophene-2-carbonitrile?
The IUPAC name of 4-[ethyl-[2,2,2-trifluoro-1-(4-fluorophenyl)ethyl]amino]sulfanylthiophene-2-carbonitrile (CID 168898432) is 4-[ethyl-[2,2,2-trifluoro-1-(4-fluorophenyl)ethyl]amino]sulfanylthiophene-2-carbonitrile.
What is the SMILES notation for 4-[ethyl-[2,2,2-trifluoro-1-(4-fluorophenyl)ethyl]amino]sulfanylthiophene-2-carbonitrile?
The canonical SMILES for 4-[ethyl-[2,2,2-trifluoro-1-(4-fluorophenyl)ethyl]amino]sulfanylthiophene-2-carbonitrile is CCN(Sc1csc(C#N)c1)C(c1ccc(F)cc1)C(F)(F)F.
What is the InChIKey of 4-[ethyl-[2,2,2-trifluoro-1-(4-fluorophenyl)ethyl]amino]sulfanylthiophene-2-carbonitrile?
The InChIKey is HXFFPCKKFYWOAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12F4N2S2/c1-2-21(23-13-7-12(8-20)22-9-13)14(15(17,18)19)10-3-5-11(16)6-4-10/h3-7,9,14H,2H2,1H3.
What are the key properties of 4-[ethyl-[2,2,2-trifluoro-1-(4-fluorophenyl)ethyl]amino]sulfanylthiophene-2-carbonitrile?
4-[ethyl-[2,2,2-trifluoro-1-(4-fluorophenyl)ethyl]amino]sulfanylthiophene-2-carbonitrile has a molecular weight of 360.40 g/mol, XLogP of 5.39, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[ethyl-[2,2,2-trifluoro-1-(4-fluorophenyl)ethyl]amino]sulfanylthiophene-2-carbonitrile is sourced from PubChem (CID 168898432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).