About N-ethenyl-1-(2-methylimidazol-1-yl)methanimine;2-methylpropane
N-ethenyl-1-(2-methylimidazol-1-yl)methanimine;2-methylpropane (PubChem CID 168898441) has the molecular formula C11H19N3
and a molecular weight of 193.29 g/mol. Its IUPAC name is N-ethenyl-1-(2-methylimidazol-1-yl)methanimine;2-methylpropane.
Molecular Properties
| Compound Name | N-ethenyl-1-(2-methylimidazol-1-yl)methanimine;2-methylpropane |
| PubChem CID | 168898441 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | N-ethenyl-1-(2-methylimidazol-1-yl)methanimine;2-methylpropane |
| SMILES | C=C/N=C/n1ccnc1C.CC(C)C |
| InChI | InChI=1S/C7H9N3.C4H10/c1-3-8-6-10-5-4-9-7(10)2;1-4(2)3/h3-6H,1H2,2H3;4H,1-3H3/b8-6+; |
| InChIKey | NJNZWNJZOSBFBP-WVLIHFOGSA-N |
| XLogP | 2.87 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-ethenyl-1-(2-methylimidazol-1-yl)methanimine;2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethenyl-1-(2-methylimidazol-1-yl)methanimine;2-methylpropane?
The IUPAC name of N-ethenyl-1-(2-methylimidazol-1-yl)methanimine;2-methylpropane (CID 168898441) is N-ethenyl-1-(2-methylimidazol-1-yl)methanimine;2-methylpropane.
What is the SMILES notation for N-ethenyl-1-(2-methylimidazol-1-yl)methanimine;2-methylpropane?
The canonical SMILES for N-ethenyl-1-(2-methylimidazol-1-yl)methanimine;2-methylpropane is C=C/N=C/n1ccnc1C.CC(C)C.
What is the InChIKey of N-ethenyl-1-(2-methylimidazol-1-yl)methanimine;2-methylpropane?
The InChIKey is NJNZWNJZOSBFBP-WVLIHFOGSA-N. The full InChI is InChI=1S/C7H9N3.C4H10/c1-3-8-6-10-5-4-9-7(10)2;1-4(2)3/h3-6H,1H2,2H3;4H,1-3H3/b8-6+;.
What are the key properties of N-ethenyl-1-(2-methylimidazol-1-yl)methanimine;2-methylpropane?
N-ethenyl-1-(2-methylimidazol-1-yl)methanimine;2-methylpropane has a molecular weight of 193.29 g/mol, XLogP of 2.87, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethenyl-1-(2-methylimidazol-1-yl)methanimine;2-methylpropane is sourced from PubChem (CID 168898441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).