C16H14F4N4S — CID 168898539
N-ethyl-2,2,2-trifluoro-1-(4-fluorophenyl)-N-imidazo[1,2-b]pyridazin-3-ylsulfanylethanamine (PubChem CID 168898539) has the molecular formula C16H14F4N4S and a molecular weight of 370.38 g/mol. Its IUPAC name is N-ethyl-2,2,2-trifluoro-1-(4-fluorophenyl)-N-imidazo[1,2-b]pyridazin-3-ylsulfanylethanamine.
| Compound Name | N-ethyl-2,2,2-trifluoro-1-(4-fluorophenyl)-N-imidazo[1,2-b]pyridazin-3-ylsulfanylethanamine |
|---|---|
| PubChem CID | 168898539 |
| Molecular Formula | C16H14F4N4S |
| Molecular Weight | 370.38 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | N-ethyl-2,2,2-trifluoro-1-(4-fluorophenyl)-N-imidazo[1,2-b]pyridazin-3-ylsulfanylethanamine |
| SMILES | CCN(Sc1cnc2cccnn12)C(c1ccc(F)cc1)C(F)(F)F |
| InChI | InChI=1S/C16H14F4N4S/c1-2-23(25-14-10-21-13-4-3-9-22-24(13)14)15(16(18,19)20)11-5-7-12(17)8-6-11/h3-10,15H,2H2,1H3 |
| InChIKey | PZRWHOJKLVGZFU-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 33.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.38 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|