C15H21F6NOS — CID 168898775
N-tert-butylsulfanyl-2,2,2-trifluoro-1-[3-methyl-4-(trifluoromethyl)phenyl]ethanamine;methanol (PubChem CID 168898775) has the molecular formula C15H21F6NOS and a molecular weight of 377.39 g/mol. Its IUPAC name is N-tert-butylsulfanyl-2,2,2-trifluoro-1-[3-methyl-4-(trifluoromethyl)phenyl]ethanamine;methanol.
| Compound Name | N-tert-butylsulfanyl-2,2,2-trifluoro-1-[3-methyl-4-(trifluoromethyl)phenyl]ethanamine;methanol |
|---|---|
| PubChem CID | 168898775 |
| Molecular Formula | C15H21F6NOS |
| Molecular Weight | 377.39 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | N-tert-butylsulfanyl-2,2,2-trifluoro-1-[3-methyl-4-(trifluoromethyl)phenyl]ethanamine;methanol |
| SMILES | CO.Cc1cc(C(NSC(C)(C)C)C(F)(F)F)ccc1C(F)(F)F |
| InChI | InChI=1S/C14H17F6NS.CH4O/c1-8-7-9(5-6-10(8)13(15,16)17)11(14(18,19)20)21-22-12(2,3)4;1-2/h5-7,11,21H,1-4H3;2H,1H3 |
| InChIKey | DTFNCRBFUFSHAM-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.39 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|