2-methylimidazo[1,2-b]pyridazine-6-sulfonyl chloride

C7H6ClN3O2S — CID 168899055

IUPAC2-methylimidazo[1,2-b]pyridazine-6-sulfonyl chloride
SMILESCc1cn2nc(S(=O)(=O)Cl)ccc2n1
InChIInChI=1S/C7H6ClN3O2S/c1-5-4-11-6(9-5)2-3-7(10-11)14(8,12)13/h2-4H,1H3
InChIKeyYACUCGNXQRSXKR-UHFFFAOYSA-N
MW231.66 g/mol
LogP0.97
Rot. Bonds1

About 2-methylimidazo[1,2-b]pyridazine-6-sulfonyl chloride

2-methylimidazo[1,2-b]pyridazine-6-sulfonyl chloride (PubChem CID 168899055) has the molecular formula C7H6ClN3O2S and a molecular weight of 231.66 g/mol. Its IUPAC name is 2-methylimidazo[1,2-b]pyridazine-6-sulfonyl chloride.

Molecular Properties

Compound Name2-methylimidazo[1,2-b]pyridazine-6-sulfonyl chloride
PubChem CID168899055
Molecular FormulaC7H6ClN3O2S
Molecular Weight231.66 g/mol
Exact Mass230.99
IUPAC Name2-methylimidazo[1,2-b]pyridazine-6-sulfonyl chloride
SMILESCc1cn2nc(S(=O)(=O)Cl)ccc2n1
InChIInChI=1S/C7H6ClN3O2S/c1-5-4-11-6(9-5)2-3-7(10-11)14(8,12)13/h2-4H,1H3
InChIKeyYACUCGNXQRSXKR-UHFFFAOYSA-N
XLogP0.97
TPSA64.33 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds1
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500231.66
LogP ≤ 50.97
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze 2-methylimidazo[1,2-b]pyridazine-6-sulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-methylimidazo[1,2-b]pyridazine-6-sulfonyl chloride?
The IUPAC name of 2-methylimidazo[1,2-b]pyridazine-6-sulfonyl chloride (CID 168899055) is 2-methylimidazo[1,2-b]pyridazine-6-sulfonyl chloride.
What is the SMILES notation for 2-methylimidazo[1,2-b]pyridazine-6-sulfonyl chloride?
The canonical SMILES for 2-methylimidazo[1,2-b]pyridazine-6-sulfonyl chloride is Cc1cn2nc(S(=O)(=O)Cl)ccc2n1.
What is the InChIKey of 2-methylimidazo[1,2-b]pyridazine-6-sulfonyl chloride?
The InChIKey is YACUCGNXQRSXKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6ClN3O2S/c1-5-4-11-6(9-5)2-3-7(10-11)14(8,12)13/h2-4H,1H3.
What are the key properties of 2-methylimidazo[1,2-b]pyridazine-6-sulfonyl chloride?
2-methylimidazo[1,2-b]pyridazine-6-sulfonyl chloride has a molecular weight of 231.66 g/mol, XLogP of 0.97, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylimidazo[1,2-b]pyridazine-6-sulfonyl chloride is sourced from PubChem (CID 168899055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).