About 2-methylimidazo[1,2-b]pyridazine-6-sulfonyl chloride
2-methylimidazo[1,2-b]pyridazine-6-sulfonyl chloride (PubChem CID 168899055) has the molecular formula C7H6ClN3O2S
and a molecular weight of 231.66 g/mol. Its IUPAC name is 2-methylimidazo[1,2-b]pyridazine-6-sulfonyl chloride.
Molecular Properties
| Compound Name | 2-methylimidazo[1,2-b]pyridazine-6-sulfonyl chloride |
| PubChem CID | 168899055 |
| Molecular Formula | C7H6ClN3O2S |
| Molecular Weight | 231.66 g/mol |
| Exact Mass | 230.99 |
| IUPAC Name | 2-methylimidazo[1,2-b]pyridazine-6-sulfonyl chloride |
| SMILES | Cc1cn2nc(S(=O)(=O)Cl)ccc2n1 |
| InChI | InChI=1S/C7H6ClN3O2S/c1-5-4-11-6(9-5)2-3-7(10-11)14(8,12)13/h2-4H,1H3 |
| InChIKey | YACUCGNXQRSXKR-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 64.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.66 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-methylimidazo[1,2-b]pyridazine-6-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylimidazo[1,2-b]pyridazine-6-sulfonyl chloride?
The IUPAC name of 2-methylimidazo[1,2-b]pyridazine-6-sulfonyl chloride (CID 168899055) is 2-methylimidazo[1,2-b]pyridazine-6-sulfonyl chloride.
What is the SMILES notation for 2-methylimidazo[1,2-b]pyridazine-6-sulfonyl chloride?
The canonical SMILES for 2-methylimidazo[1,2-b]pyridazine-6-sulfonyl chloride is Cc1cn2nc(S(=O)(=O)Cl)ccc2n1.
What is the InChIKey of 2-methylimidazo[1,2-b]pyridazine-6-sulfonyl chloride?
The InChIKey is YACUCGNXQRSXKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6ClN3O2S/c1-5-4-11-6(9-5)2-3-7(10-11)14(8,12)13/h2-4H,1H3.
What are the key properties of 2-methylimidazo[1,2-b]pyridazine-6-sulfonyl chloride?
2-methylimidazo[1,2-b]pyridazine-6-sulfonyl chloride has a molecular weight of 231.66 g/mol, XLogP of 0.97, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylimidazo[1,2-b]pyridazine-6-sulfonyl chloride is sourced from PubChem (CID 168899055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).