About N-methyl-N-[2,2,2-trifluoro-1-(4-methoxyphenyl)ethyl]oxane-4-sulfonamide
N-methyl-N-[2,2,2-trifluoro-1-(4-methoxyphenyl)ethyl]oxane-4-sulfonamide (PubChem CID 168899076) has the molecular formula C15H20F3NO4S
and a molecular weight of 367.39 g/mol. Its IUPAC name is N-methyl-N-[2,2,2-trifluoro-1-(4-methoxyphenyl)ethyl]oxane-4-sulfonamide.
Molecular Properties
| Compound Name | N-methyl-N-[2,2,2-trifluoro-1-(4-methoxyphenyl)ethyl]oxane-4-sulfonamide |
| PubChem CID | 168899076 |
| Molecular Formula | C15H20F3NO4S |
| Molecular Weight | 367.39 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | N-methyl-N-[2,2,2-trifluoro-1-(4-methoxyphenyl)ethyl]oxane-4-sulfonamide |
| SMILES | COc1ccc(C(N(C)S(=O)(=O)C2CCOCC2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H20F3NO4S/c1-19(24(20,21)13-7-9-23-10-8-13)14(15(16,17)18)11-3-5-12(22-2)6-4-11/h3-6,13-14H,7-10H2,1-2H3 |
| InChIKey | LERJELLRRWQJCB-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.39 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-methyl-N-[2,2,2-trifluoro-1-(4-methoxyphenyl)ethyl]oxane-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N-[2,2,2-trifluoro-1-(4-methoxyphenyl)ethyl]oxane-4-sulfonamide?
The IUPAC name of N-methyl-N-[2,2,2-trifluoro-1-(4-methoxyphenyl)ethyl]oxane-4-sulfonamide (CID 168899076) is N-methyl-N-[2,2,2-trifluoro-1-(4-methoxyphenyl)ethyl]oxane-4-sulfonamide.
What is the SMILES notation for N-methyl-N-[2,2,2-trifluoro-1-(4-methoxyphenyl)ethyl]oxane-4-sulfonamide?
The canonical SMILES for N-methyl-N-[2,2,2-trifluoro-1-(4-methoxyphenyl)ethyl]oxane-4-sulfonamide is COc1ccc(C(N(C)S(=O)(=O)C2CCOCC2)C(F)(F)F)cc1.
What is the InChIKey of N-methyl-N-[2,2,2-trifluoro-1-(4-methoxyphenyl)ethyl]oxane-4-sulfonamide?
The InChIKey is LERJELLRRWQJCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20F3NO4S/c1-19(24(20,21)13-7-9-23-10-8-13)14(15(16,17)18)11-3-5-12(22-2)6-4-11/h3-6,13-14H,7-10H2,1-2H3.
What are the key properties of N-methyl-N-[2,2,2-trifluoro-1-(4-methoxyphenyl)ethyl]oxane-4-sulfonamide?
N-methyl-N-[2,2,2-trifluoro-1-(4-methoxyphenyl)ethyl]oxane-4-sulfonamide has a molecular weight of 367.39 g/mol, XLogP of 2.74, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-[2,2,2-trifluoro-1-(4-methoxyphenyl)ethyl]oxane-4-sulfonamide is sourced from PubChem (CID 168899076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).