C16H13ClF3N3S — CID 168899219
(1R)-1-(4-chlorophenyl)-2,2,2-trifluoro-N-imidazo[1,2-a]pyridin-7-ylsulfanyl-N-methylethanamine (PubChem CID 168899219) has the molecular formula C16H13ClF3N3S and a molecular weight of 371.82 g/mol. Its IUPAC name is (1R)-1-(4-chlorophenyl)-2,2,2-trifluoro-N-imidazo[1,2-a]pyridin-7-ylsulfanyl-N-methylethanamine.
| Compound Name | (1R)-1-(4-chlorophenyl)-2,2,2-trifluoro-N-imidazo[1,2-a]pyridin-7-ylsulfanyl-N-methylethanamine |
|---|---|
| PubChem CID | 168899219 |
| Molecular Formula | C16H13ClF3N3S |
| Molecular Weight | 371.82 g/mol |
| Exact Mass | 371.05 |
| IUPAC Name | (1R)-1-(4-chlorophenyl)-2,2,2-trifluoro-N-imidazo[1,2-a]pyridin-7-ylsulfanyl-N-methylethanamine |
| SMILES | CN(Sc1ccn2ccnc2c1)[C@H](c1ccc(Cl)cc1)C(F)(F)F |
| InChI | InChI=1S/C16H13ClF3N3S/c1-22(24-13-6-8-23-9-7-21-14(23)10-13)15(16(18,19)20)11-2-4-12(17)5-3-11/h2-10,15H,1H3/t15-/m1/s1 |
| InChIKey | GACYUYLYINDXHP-OAHLLOKOSA-N |
| XLogP | 5.23 |
| TPSA | 20.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.82 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|