C34H40FN5O — CID 168899683
1-[4-[7-(2-cyclopropyl-6-methylphenyl)-6-fluoro-2-[2-(1,2,3,5,6,7-hexahydropyrrolizin-8-yl)ethyl]quinazolin-4-yl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 168899683) has the molecular formula C34H40FN5O and a molecular weight of 553.73 g/mol. Its IUPAC name is 1-[4-[7-(2-cyclopropyl-6-methylphenyl)-6-fluoro-2-[2-(1,2,3,5,6,7-hexahydropyrrolizin-8-yl)ethyl]quinazolin-4-yl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[7-(2-cyclopropyl-6-methylphenyl)-6-fluoro-2-[2-(1,2,3,5,6,7-hexahydropyrrolizin-8-yl)ethyl]quinazolin-4-yl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 168899683 |
| Molecular Formula | C34H40FN5O |
| Molecular Weight | 553.73 g/mol |
| Exact Mass | 553.32 |
| IUPAC Name | 1-[4-[7-(2-cyclopropyl-6-methylphenyl)-6-fluoro-2-[2-(1,2,3,5,6,7-hexahydropyrrolizin-8-yl)ethyl]quinazolin-4-yl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCN(c2nc(CCC34CCCN3CCC4)nc3cc(-c4c(C)cccc4C4CC4)c(F)cc23)CC1 |
| InChI | InChI=1S/C34H40FN5O/c1-3-31(41)38-17-19-39(20-18-38)33-27-21-28(35)26(32-23(2)7-4-8-25(32)24-9-10-24)22-29(27)36-30(37-33)11-14-34-12-5-15-40(34)16-6-13-34/h3-4,7-8,21-22,24H,1,5-6,9-20H2,2H3 |
| InChIKey | UMDHJAZNNONIBZ-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 52.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.73 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|