C9H18O3 — CID 168899706
(2R,5R)-6-(hydroxymethyl)-2,4,5-trimethyloxan-3-ol (PubChem CID 168899706) has the molecular formula C9H18O3 and a molecular weight of 174.24 g/mol. Its IUPAC name is (2R,5R)-6-(hydroxymethyl)-2,4,5-trimethyloxan-3-ol.
| Compound Name | (2R,5R)-6-(hydroxymethyl)-2,4,5-trimethyloxan-3-ol |
|---|---|
| PubChem CID | 168899706 |
| Molecular Formula | C9H18O3 |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.13 |
| IUPAC Name | (2R,5R)-6-(hydroxymethyl)-2,4,5-trimethyloxan-3-ol |
| SMILES | CC1C(O)[C@@H](C)OC(CO)[C@@H]1C |
| InChI | InChI=1S/C9H18O3/c1-5-6(2)9(11)7(3)12-8(5)4-10/h5-11H,4H2,1-3H3/t5-,6?,7-,8?,9?/m1/s1 |
| InChIKey | XXSAHAWPGNODHN-WCYMSPOYSA-N |
| XLogP | 0.40 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |