About 3,3-dimethyl-1-prop-1-en-2-ylpiperidin-2-imine;ethane
3,3-dimethyl-1-prop-1-en-2-ylpiperidin-2-imine;ethane (PubChem CID 168899850) has the molecular formula C12H24N2
and a molecular weight of 196.34 g/mol. Its IUPAC name is 3,3-dimethyl-1-prop-1-en-2-ylpiperidin-2-imine;ethane.
Molecular Properties
| Compound Name | 3,3-dimethyl-1-prop-1-en-2-ylpiperidin-2-imine;ethane |
| PubChem CID | 168899850 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | 3,3-dimethyl-1-prop-1-en-2-ylpiperidin-2-imine;ethane |
| SMILES | CC.[H]/N=C1/N(C(=C)C)CCCC1(C)C |
| InChI | InChI=1S/C10H18N2.C2H6/c1-8(2)12-7-5-6-10(3,4)9(12)11;1-2/h11H,1,5-7H2,2-4H3;1-2H3/b11-9+; |
| InChIKey | VKGAUKZBSABAQR-LBEJWNQZSA-N |
| XLogP | 3.65 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3,3-dimethyl-1-prop-1-en-2-ylpiperidin-2-imine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dimethyl-1-prop-1-en-2-ylpiperidin-2-imine;ethane?
The IUPAC name of 3,3-dimethyl-1-prop-1-en-2-ylpiperidin-2-imine;ethane (CID 168899850) is 3,3-dimethyl-1-prop-1-en-2-ylpiperidin-2-imine;ethane.
What is the SMILES notation for 3,3-dimethyl-1-prop-1-en-2-ylpiperidin-2-imine;ethane?
The canonical SMILES for 3,3-dimethyl-1-prop-1-en-2-ylpiperidin-2-imine;ethane is CC.[H]/N=C1/N(C(=C)C)CCCC1(C)C.
What is the InChIKey of 3,3-dimethyl-1-prop-1-en-2-ylpiperidin-2-imine;ethane?
The InChIKey is VKGAUKZBSABAQR-LBEJWNQZSA-N. The full InChI is InChI=1S/C10H18N2.C2H6/c1-8(2)12-7-5-6-10(3,4)9(12)11;1-2/h11H,1,5-7H2,2-4H3;1-2H3/b11-9+;.
What are the key properties of 3,3-dimethyl-1-prop-1-en-2-ylpiperidin-2-imine;ethane?
3,3-dimethyl-1-prop-1-en-2-ylpiperidin-2-imine;ethane has a molecular weight of 196.34 g/mol, XLogP of 3.65, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethyl-1-prop-1-en-2-ylpiperidin-2-imine;ethane is sourced from PubChem (CID 168899850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).