C15H18FN3O2S — CID 168900456
5-[2-fluoro-6-hydroxy-3-(5-propyl-2,5-dihydro-1H-pyrrol-3-yl)phenyl]-1,2,5-thiadiazolidin-3-one (PubChem CID 168900456) has the molecular formula C15H18FN3O2S and a molecular weight of 323.39 g/mol. Its IUPAC name is 5-[2-fluoro-6-hydroxy-3-(5-propyl-2,5-dihydro-1H-pyrrol-3-yl)phenyl]-1,2,5-thiadiazolidin-3-one.
| Compound Name | 5-[2-fluoro-6-hydroxy-3-(5-propyl-2,5-dihydro-1H-pyrrol-3-yl)phenyl]-1,2,5-thiadiazolidin-3-one |
|---|---|
| PubChem CID | 168900456 |
| Molecular Formula | C15H18FN3O2S |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | 5-[2-fluoro-6-hydroxy-3-(5-propyl-2,5-dihydro-1H-pyrrol-3-yl)phenyl]-1,2,5-thiadiazolidin-3-one |
| SMILES | CCCC1C=C(c2ccc(O)c(N3CC(=O)NS3)c2F)CN1 |
| InChI | InChI=1S/C15H18FN3O2S/c1-2-3-10-6-9(7-17-10)11-4-5-12(20)15(14(11)16)19-8-13(21)18-22-19/h4-6,10,17,20H,2-3,7-8H2,1H3,(H,18,21) |
| InChIKey | UMRXLUQPJRKLDQ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|