About 5-[3-(1-cyclopropylimidazol-4-yl)-2-fluoro-6-hydroxyphenyl]-1,1-dioxo-1,2-thiazol-3-one
5-[3-(1-cyclopropylimidazol-4-yl)-2-fluoro-6-hydroxyphenyl]-1,1-dioxo-1,2-thiazol-3-one (PubChem CID 168900792) has the molecular formula C15H12FN3O4S
and a molecular weight of 349.34 g/mol. Its IUPAC name is 5-[3-(1-cyclopropylimidazol-4-yl)-2-fluoro-6-hydroxyphenyl]-1,1-dioxo-1,2-thiazol-3-one.
Molecular Properties
| Compound Name | 5-[3-(1-cyclopropylimidazol-4-yl)-2-fluoro-6-hydroxyphenyl]-1,1-dioxo-1,2-thiazol-3-one |
| PubChem CID | 168900792 |
| Molecular Formula | C15H12FN3O4S |
| Molecular Weight | 349.34 g/mol |
| Exact Mass | 349.05 |
| IUPAC Name | 5-[3-(1-cyclopropylimidazol-4-yl)-2-fluoro-6-hydroxyphenyl]-1,1-dioxo-1,2-thiazol-3-one |
| SMILES | O=C1C=C(c2c(O)ccc(-c3cn(C4CC4)cn3)c2F)S(=O)(=O)N1 |
| InChI | InChI=1S/C15H12FN3O4S/c16-15-9(10-6-19(7-17-10)8-1-2-8)3-4-11(20)14(15)12-5-13(21)18-24(12,22)23/h3-8,20H,1-2H2,(H,18,21) |
| InChIKey | GYDKWLDSCQQGOU-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.34 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[3-(1-cyclopropylimidazol-4-yl)-2-fluoro-6-hydroxyphenyl]-1,1-dioxo-1,2-thiazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3-(1-cyclopropylimidazol-4-yl)-2-fluoro-6-hydroxyphenyl]-1,1-dioxo-1,2-thiazol-3-one?
The IUPAC name of 5-[3-(1-cyclopropylimidazol-4-yl)-2-fluoro-6-hydroxyphenyl]-1,1-dioxo-1,2-thiazol-3-one (CID 168900792) is 5-[3-(1-cyclopropylimidazol-4-yl)-2-fluoro-6-hydroxyphenyl]-1,1-dioxo-1,2-thiazol-3-one.
What is the SMILES notation for 5-[3-(1-cyclopropylimidazol-4-yl)-2-fluoro-6-hydroxyphenyl]-1,1-dioxo-1,2-thiazol-3-one?
The canonical SMILES for 5-[3-(1-cyclopropylimidazol-4-yl)-2-fluoro-6-hydroxyphenyl]-1,1-dioxo-1,2-thiazol-3-one is O=C1C=C(c2c(O)ccc(-c3cn(C4CC4)cn3)c2F)S(=O)(=O)N1.
What is the InChIKey of 5-[3-(1-cyclopropylimidazol-4-yl)-2-fluoro-6-hydroxyphenyl]-1,1-dioxo-1,2-thiazol-3-one?
The InChIKey is GYDKWLDSCQQGOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12FN3O4S/c16-15-9(10-6-19(7-17-10)8-1-2-8)3-4-11(20)14(15)12-5-13(21)18-24(12,22)23/h3-8,20H,1-2H2,(H,18,21).
What are the key properties of 5-[3-(1-cyclopropylimidazol-4-yl)-2-fluoro-6-hydroxyphenyl]-1,1-dioxo-1,2-thiazol-3-one?
5-[3-(1-cyclopropylimidazol-4-yl)-2-fluoro-6-hydroxyphenyl]-1,1-dioxo-1,2-thiazol-3-one has a molecular weight of 349.34 g/mol, XLogP of 1.53, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3-(1-cyclopropylimidazol-4-yl)-2-fluoro-6-hydroxyphenyl]-1,1-dioxo-1,2-thiazol-3-one is sourced from PubChem (CID 168900792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).