About 1-[4-[(3Z)-hexa-1,3,5-trien-2-yl]oxybutyl]-4-methylpiperazine
1-[4-[(3Z)-hexa-1,3,5-trien-2-yl]oxybutyl]-4-methylpiperazine (PubChem CID 168901669) has the molecular formula C15H26N2O
and a molecular weight of 250.39 g/mol. Its IUPAC name is 1-[4-[(3Z)-hexa-1,3,5-trien-2-yl]oxybutyl]-4-methylpiperazine.
Molecular Properties
| Compound Name | 1-[4-[(3Z)-hexa-1,3,5-trien-2-yl]oxybutyl]-4-methylpiperazine |
| PubChem CID | 168901669 |
| Molecular Formula | C15H26N2O |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.20 |
| IUPAC Name | 1-[4-[(3Z)-hexa-1,3,5-trien-2-yl]oxybutyl]-4-methylpiperazine |
| SMILES | C=C/C=C\C(=C)OCCCCN1CCN(C)CC1 |
| InChI | InChI=1S/C15H26N2O/c1-4-5-8-15(2)18-14-7-6-9-17-12-10-16(3)11-13-17/h4-5,8H,1-2,6-7,9-14H2,3H3/b8-5- |
| InChIKey | LRRSORFQIXVGDM-YVMONPNESA-N |
| XLogP | 2.29 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-[(3Z)-hexa-1,3,5-trien-2-yl]oxybutyl]-4-methylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-[(3Z)-hexa-1,3,5-trien-2-yl]oxybutyl]-4-methylpiperazine?
The IUPAC name of 1-[4-[(3Z)-hexa-1,3,5-trien-2-yl]oxybutyl]-4-methylpiperazine (CID 168901669) is 1-[4-[(3Z)-hexa-1,3,5-trien-2-yl]oxybutyl]-4-methylpiperazine.
What is the SMILES notation for 1-[4-[(3Z)-hexa-1,3,5-trien-2-yl]oxybutyl]-4-methylpiperazine?
The canonical SMILES for 1-[4-[(3Z)-hexa-1,3,5-trien-2-yl]oxybutyl]-4-methylpiperazine is C=C/C=C\C(=C)OCCCCN1CCN(C)CC1.
What is the InChIKey of 1-[4-[(3Z)-hexa-1,3,5-trien-2-yl]oxybutyl]-4-methylpiperazine?
The InChIKey is LRRSORFQIXVGDM-YVMONPNESA-N. The full InChI is InChI=1S/C15H26N2O/c1-4-5-8-15(2)18-14-7-6-9-17-12-10-16(3)11-13-17/h4-5,8H,1-2,6-7,9-14H2,3H3/b8-5-.
What are the key properties of 1-[4-[(3Z)-hexa-1,3,5-trien-2-yl]oxybutyl]-4-methylpiperazine?
1-[4-[(3Z)-hexa-1,3,5-trien-2-yl]oxybutyl]-4-methylpiperazine has a molecular weight of 250.39 g/mol, XLogP of 2.29, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-[(3Z)-hexa-1,3,5-trien-2-yl]oxybutyl]-4-methylpiperazine is sourced from PubChem (CID 168901669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).