C25H25N5O5 — CID 168901772
2-[3-[5-[7-amino-2-(2-hydroxyphenyl)imidazo[1,2-a]pyrimidin-6-yl]pent-4-ynoxy]-1,2-oxazol-5-yl]-3-methylbutanoic acid (PubChem CID 168901772) has the molecular formula C25H25N5O5 and a molecular weight of 475.51 g/mol. Its IUPAC name is 2-[3-[5-[7-amino-2-(2-hydroxyphenyl)imidazo[1,2-a]pyrimidin-6-yl]pent-4-ynoxy]-1,2-oxazol-5-yl]-3-methylbutanoic acid.
| Compound Name | 2-[3-[5-[7-amino-2-(2-hydroxyphenyl)imidazo[1,2-a]pyrimidin-6-yl]pent-4-ynoxy]-1,2-oxazol-5-yl]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 168901772 |
| Molecular Formula | C25H25N5O5 |
| Molecular Weight | 475.51 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | 2-[3-[5-[7-amino-2-(2-hydroxyphenyl)imidazo[1,2-a]pyrimidin-6-yl]pent-4-ynoxy]-1,2-oxazol-5-yl]-3-methylbutanoic acid |
| SMILES | CC(C)C(C(=O)O)c1cc(OCCCC#Cc2cn3cc(-c4ccccc4O)nc3nc2N)no1 |
| InChI | InChI=1S/C25H25N5O5/c1-15(2)22(24(32)33)20-12-21(29-35-20)34-11-7-3-4-8-16-13-30-14-18(27-25(30)28-23(16)26)17-9-5-6-10-19(17)31/h5-6,9-10,12-15,22,31H,3,7,11H2,1-2H3,(H,32,33)(H2,26,27,28) |
| InChIKey | FSNUJKNNPXLMKU-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 149.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.51 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|