C31H29ClIN10O4S- — CID 168902066
N-(2-chloro-6-methylphenyl)-2-[[6-[4-[[3-(2,4-dioxopyrimidin-1-yl)phenyl]carbamoyliodanuidyl]piperazin-1-yl]-2-methylpyrimidin-4-yl]amino]-1,3-thiazole-5-carboxamide (PubChem CID 168902066) has the molecular formula C31H29ClIN10O4S- and a molecular weight of 800.06 g/mol. Its IUPAC name is N-(2-chloro-6-methylphenyl)-2-[[6-[4-[[3-(2,4-dioxopyrimidin-1-yl)phenyl]carbamoyliodanuidyl]piperazin-1-yl]-2-methylpyrimidin-4-yl]amino]-1,3-thiazole-5-carboxamide.
| Compound Name | N-(2-chloro-6-methylphenyl)-2-[[6-[4-[[3-(2,4-dioxopyrimidin-1-yl)phenyl]carbamoyliodanuidyl]piperazin-1-yl]-2-methylpyrimidin-4-yl]amino]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 168902066 |
| Molecular Formula | C31H29ClIN10O4S- |
| Molecular Weight | 800.06 g/mol |
| Exact Mass | 799.08 |
| IUPAC Name | N-(2-chloro-6-methylphenyl)-2-[[6-[4-[[3-(2,4-dioxopyrimidin-1-yl)phenyl]carbamoyliodanuidyl]piperazin-1-yl]-2-methylpyrimidin-4-yl]amino]-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(Nc2ncc(C(=O)Nc3c(C)cccc3Cl)s2)cc(N2CCN([I-]C(=O)Nc3cccc(-n4ccc(=O)[nH]c4=O)c3)CC2)n1 |
| InChI | InChI=1S/C31H29ClIN10O4S/c1-18-5-3-8-22(32)27(18)40-28(45)23-17-34-30(48-23)38-24-16-25(36-19(2)35-24)41-11-13-42(14-12-41)33-29(46)37-20-6-4-7-21(15-20)43-10-9-26(44)39-31(43)47/h3-10,15-17H,11-14H2,1-2H3,(H,37,46)(H,40,45)(H,39,44,47)(H,34,35,36,38)/q-1 |
| InChIKey | QLFBNNPATJDLMT-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 170.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.06 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|