About tert-butyl 4-[5-(2,7-dimethylindazol-5-yl)-7-fluoroindazol-2-yl]piperidine-1-carboxylate
tert-butyl 4-[5-(2,7-dimethylindazol-5-yl)-7-fluoroindazol-2-yl]piperidine-1-carboxylate (PubChem CID 168902449) has the molecular formula C26H30FN5O2
and a molecular weight of 463.56 g/mol. Its IUPAC name is tert-butyl 4-[5-(2,7-dimethylindazol-5-yl)-7-fluoroindazol-2-yl]piperidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 4-[5-(2,7-dimethylindazol-5-yl)-7-fluoroindazol-2-yl]piperidine-1-carboxylate |
| PubChem CID | 168902449 |
| Molecular Formula | C26H30FN5O2 |
| Molecular Weight | 463.56 g/mol |
| Exact Mass | 463.24 |
| IUPAC Name | tert-butyl 4-[5-(2,7-dimethylindazol-5-yl)-7-fluoroindazol-2-yl]piperidine-1-carboxylate |
| SMILES | Cc1cc(-c2cc(F)c3nn(C4CCN(C(=O)OC(C)(C)C)CC4)cc3c2)cc2cn(C)nc12 |
| InChI | InChI=1S/C26H30FN5O2/c1-16-10-17(11-19-14-30(5)28-23(16)19)18-12-20-15-32(29-24(20)22(27)13-18)21-6-8-31(9-7-21)25(33)34-26(2,3)4/h10-15,21H,6-9H2,1-5H3 |
| InChIKey | UEFZPYQHTRYRBZ-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 65.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 463.56 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze tert-butyl 4-[5-(2,7-dimethylindazol-5-yl)-7-fluoroindazol-2-yl]piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-[5-(2,7-dimethylindazol-5-yl)-7-fluoroindazol-2-yl]piperidine-1-carboxylate?
The IUPAC name of tert-butyl 4-[5-(2,7-dimethylindazol-5-yl)-7-fluoroindazol-2-yl]piperidine-1-carboxylate (CID 168902449) is tert-butyl 4-[5-(2,7-dimethylindazol-5-yl)-7-fluoroindazol-2-yl]piperidine-1-carboxylate.
What is the SMILES notation for tert-butyl 4-[5-(2,7-dimethylindazol-5-yl)-7-fluoroindazol-2-yl]piperidine-1-carboxylate?
The canonical SMILES for tert-butyl 4-[5-(2,7-dimethylindazol-5-yl)-7-fluoroindazol-2-yl]piperidine-1-carboxylate is Cc1cc(-c2cc(F)c3nn(C4CCN(C(=O)OC(C)(C)C)CC4)cc3c2)cc2cn(C)nc12.
What is the InChIKey of tert-butyl 4-[5-(2,7-dimethylindazol-5-yl)-7-fluoroindazol-2-yl]piperidine-1-carboxylate?
The InChIKey is UEFZPYQHTRYRBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H30FN5O2/c1-16-10-17(11-19-14-30(5)28-23(16)19)18-12-20-15-32(29-24(20)22(27)13-18)21-6-8-31(9-7-21)25(33)34-26(2,3)4/h10-15,21H,6-9H2,1-5H3.
What are the key properties of tert-butyl 4-[5-(2,7-dimethylindazol-5-yl)-7-fluoroindazol-2-yl]piperidine-1-carboxylate?
tert-butyl 4-[5-(2,7-dimethylindazol-5-yl)-7-fluoroindazol-2-yl]piperidine-1-carboxylate has a molecular weight of 463.56 g/mol, XLogP of 5.61, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-[5-(2,7-dimethylindazol-5-yl)-7-fluoroindazol-2-yl]piperidine-1-carboxylate is sourced from PubChem (CID 168902449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).