C15H23N5O — CID 168903778
ethane;N-ethenyl-N-[(3Z)-1,1,4-triamino-4-(2-hydroxyphenyl)buta-1,3-dien-2-yl]methanimidamide (PubChem CID 168903778) has the molecular formula C15H23N5O and a molecular weight of 289.38 g/mol. Its IUPAC name is ethane;N-ethenyl-N-[(3Z)-1,1,4-triamino-4-(2-hydroxyphenyl)buta-1,3-dien-2-yl]methanimidamide.
| Compound Name | ethane;N-ethenyl-N-[(3Z)-1,1,4-triamino-4-(2-hydroxyphenyl)buta-1,3-dien-2-yl]methanimidamide |
|---|---|
| PubChem CID | 168903778 |
| Molecular Formula | C15H23N5O |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.19 |
| IUPAC Name | ethane;N-ethenyl-N-[(3Z)-1,1,4-triamino-4-(2-hydroxyphenyl)buta-1,3-dien-2-yl]methanimidamide |
| SMILES | CC.[H]/N=C/N(C=C)C(/C=C(\N)c1ccccc1O)=C(N)N |
| InChI | InChI=1S/C13H17N5O.C2H6/c1-2-18(8-14)11(13(16)17)7-10(15)9-5-3-4-6-12(9)19;1-2/h2-8,14,19H,1,15-17H2;1-2H3/b10-7-,14-8+; |
| InChIKey | CJCOVDNGQJZBJO-QHVLVWMKSA-N |
| XLogP | 1.86 |
| TPSA | 125.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|