C24H38F2N6O — CID 168903858
ethane;2-[(1Z)-1,4,4-triamino-3-[8-[(4,4-difluoropiperidin-3-yl)methyl]-3,8-diazabicyclo[3.2.1]octan-3-yl]buta-1,3-dienyl]phenol (PubChem CID 168903858) has the molecular formula C24H38F2N6O and a molecular weight of 464.61 g/mol. Its IUPAC name is ethane;2-[(1Z)-1,4,4-triamino-3-[8-[(4,4-difluoropiperidin-3-yl)methyl]-3,8-diazabicyclo[3.2.1]octan-3-yl]buta-1,3-dienyl]phenol.
| Compound Name | ethane;2-[(1Z)-1,4,4-triamino-3-[8-[(4,4-difluoropiperidin-3-yl)methyl]-3,8-diazabicyclo[3.2.1]octan-3-yl]buta-1,3-dienyl]phenol |
|---|---|
| PubChem CID | 168903858 |
| Molecular Formula | C24H38F2N6O |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.31 |
| IUPAC Name | ethane;2-[(1Z)-1,4,4-triamino-3-[8-[(4,4-difluoropiperidin-3-yl)methyl]-3,8-diazabicyclo[3.2.1]octan-3-yl]buta-1,3-dienyl]phenol |
| SMILES | CC.NC(N)=C(/C=C(\N)c1ccccc1O)N1CC2CCC(C1)N2CC1CNCCC1(F)F |
| InChI | InChI=1S/C22H32F2N6O.C2H6/c23-22(24)7-8-28-10-14(22)11-30-15-5-6-16(30)13-29(12-15)19(21(26)27)9-18(25)17-3-1-2-4-20(17)31;1-2/h1-4,9,14-16,28,31H,5-8,10-13,25-27H2;1-2H3/b18-9-; |
| InChIKey | WFLBUDBPJOFTBO-NAIZSXBXSA-N |
| XLogP | 2.20 |
| TPSA | 116.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|