C29H24ClF3N6O3 — CID 168904478
4-[[6-chloro-5-[4-[4-[1-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]phenyl]phenyl]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]cyclohexane-1-carboxylic acid (PubChem CID 168904478) has the molecular formula C29H24ClF3N6O3 and a molecular weight of 597.00 g/mol. Its IUPAC name is 4-[[6-chloro-5-[4-[4-[1-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]phenyl]phenyl]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[6-chloro-5-[4-[4-[1-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]phenyl]phenyl]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 168904478 |
| Molecular Formula | C29H24ClF3N6O3 |
| Molecular Weight | 597.00 g/mol |
| Exact Mass | 596.16 |
| IUPAC Name | 4-[[6-chloro-5-[4-[4-[1-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]phenyl]phenyl]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(Oc2nc3nc(-c4ccc(-c5ccc(-c6ncn(CC(F)(F)F)n6)cc5)cc4)c(Cl)cc3[nH]2)CC1 |
| InChI | InChI=1S/C29H24ClF3N6O3/c30-22-13-23-26(37-28(35-23)42-21-11-9-20(10-12-21)27(40)41)36-24(22)18-5-1-16(2-6-18)17-3-7-19(8-4-17)25-34-15-39(38-25)14-29(31,32)33/h1-8,13,15,20-21H,9-12,14H2,(H,40,41)(H,35,36,37) |
| InChIKey | MTOFCLXESGWQLM-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 118.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.00 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |