About 8-[4-(1,1-difluoroethyl)phenoxy]quinoline-6-carbonitrile
8-[4-(1,1-difluoroethyl)phenoxy]quinoline-6-carbonitrile (PubChem CID 168904740) has the molecular formula C18H12F2N2O
and a molecular weight of 310.30 g/mol. Its IUPAC name is 8-[4-(1,1-difluoroethyl)phenoxy]quinoline-6-carbonitrile.
Molecular Properties
| Compound Name | 8-[4-(1,1-difluoroethyl)phenoxy]quinoline-6-carbonitrile |
| PubChem CID | 168904740 |
| Molecular Formula | C18H12F2N2O |
| Molecular Weight | 310.30 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | 8-[4-(1,1-difluoroethyl)phenoxy]quinoline-6-carbonitrile |
| SMILES | CC(F)(F)c1ccc(Oc2cc(C#N)cc3cccnc23)cc1 |
| InChI | InChI=1S/C18H12F2N2O/c1-18(19,20)14-4-6-15(7-5-14)23-16-10-12(11-21)9-13-3-2-8-22-17(13)16/h2-10H,1H3 |
| InChIKey | QKBARISEDNKJPZ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 310.30 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-[4-(1,1-difluoroethyl)phenoxy]quinoline-6-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[4-(1,1-difluoroethyl)phenoxy]quinoline-6-carbonitrile?
The IUPAC name of 8-[4-(1,1-difluoroethyl)phenoxy]quinoline-6-carbonitrile (CID 168904740) is 8-[4-(1,1-difluoroethyl)phenoxy]quinoline-6-carbonitrile.
What is the SMILES notation for 8-[4-(1,1-difluoroethyl)phenoxy]quinoline-6-carbonitrile?
The canonical SMILES for 8-[4-(1,1-difluoroethyl)phenoxy]quinoline-6-carbonitrile is CC(F)(F)c1ccc(Oc2cc(C#N)cc3cccnc23)cc1.
What is the InChIKey of 8-[4-(1,1-difluoroethyl)phenoxy]quinoline-6-carbonitrile?
The InChIKey is QKBARISEDNKJPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12F2N2O/c1-18(19,20)14-4-6-15(7-5-14)23-16-10-12(11-21)9-13-3-2-8-22-17(13)16/h2-10H,1H3.
What are the key properties of 8-[4-(1,1-difluoroethyl)phenoxy]quinoline-6-carbonitrile?
8-[4-(1,1-difluoroethyl)phenoxy]quinoline-6-carbonitrile has a molecular weight of 310.30 g/mol, XLogP of 5.01, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[4-(1,1-difluoroethyl)phenoxy]quinoline-6-carbonitrile is sourced from PubChem (CID 168904740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).