About 7-chloro-4-propyl-2,3-dihydro-1-benzofuran
7-chloro-4-propyl-2,3-dihydro-1-benzofuran (PubChem CID 168905043) has the molecular formula C11H13ClO
and a molecular weight of 196.68 g/mol. Its IUPAC name is 7-chloro-4-propyl-2,3-dihydro-1-benzofuran.
Molecular Properties
| Compound Name | 7-chloro-4-propyl-2,3-dihydro-1-benzofuran |
| PubChem CID | 168905043 |
| Molecular Formula | C11H13ClO |
| Molecular Weight | 196.68 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | 7-chloro-4-propyl-2,3-dihydro-1-benzofuran |
| SMILES | CCCc1ccc(Cl)c2c1CCO2 |
| InChI | InChI=1S/C11H13ClO/c1-2-3-8-4-5-10(12)11-9(8)6-7-13-11/h4-5H,2-3,6-7H2,1H3 |
| InChIKey | OPVVQEHIHIXYOK-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.68 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-chloro-4-propyl-2,3-dihydro-1-benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-4-propyl-2,3-dihydro-1-benzofuran?
The IUPAC name of 7-chloro-4-propyl-2,3-dihydro-1-benzofuran (CID 168905043) is 7-chloro-4-propyl-2,3-dihydro-1-benzofuran.
What is the SMILES notation for 7-chloro-4-propyl-2,3-dihydro-1-benzofuran?
The canonical SMILES for 7-chloro-4-propyl-2,3-dihydro-1-benzofuran is CCCc1ccc(Cl)c2c1CCO2.
What is the InChIKey of 7-chloro-4-propyl-2,3-dihydro-1-benzofuran?
The InChIKey is OPVVQEHIHIXYOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13ClO/c1-2-3-8-4-5-10(12)11-9(8)6-7-13-11/h4-5H,2-3,6-7H2,1H3.
What are the key properties of 7-chloro-4-propyl-2,3-dihydro-1-benzofuran?
7-chloro-4-propyl-2,3-dihydro-1-benzofuran has a molecular weight of 196.68 g/mol, XLogP of 3.23, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-4-propyl-2,3-dihydro-1-benzofuran is sourced from PubChem (CID 168905043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).