C20H23F2NO — CID 168905147
3-[4-(1,1-difluoroethyl)phenyl]-4-methyl-5-[(E)-2-methylbut-1-enoxy]aniline (PubChem CID 168905147) has the molecular formula C20H23F2NO and a molecular weight of 331.41 g/mol. Its IUPAC name is 3-[4-(1,1-difluoroethyl)phenyl]-4-methyl-5-[(E)-2-methylbut-1-enoxy]aniline.
| Compound Name | 3-[4-(1,1-difluoroethyl)phenyl]-4-methyl-5-[(E)-2-methylbut-1-enoxy]aniline |
|---|---|
| PubChem CID | 168905147 |
| Molecular Formula | C20H23F2NO |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | 3-[4-(1,1-difluoroethyl)phenyl]-4-methyl-5-[(E)-2-methylbut-1-enoxy]aniline |
| SMILES | CC/C(C)=C/Oc1cc(N)cc(-c2ccc(C(C)(F)F)cc2)c1C |
| InChI | InChI=1S/C20H23F2NO/c1-5-13(2)12-24-19-11-17(23)10-18(14(19)3)15-6-8-16(9-7-15)20(4,21)22/h6-12H,5,23H2,1-4H3/b13-12+ |
| InChIKey | KRTRYGPEISPZDT-OUKQBFOZSA-N |
| XLogP | 6.05 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|