About 6-bromo-2-(dimethylamino)-3-methyl-4-[4-(trifluoromethoxy)phenyl]benzonitrile;propane
6-bromo-2-(dimethylamino)-3-methyl-4-[4-(trifluoromethoxy)phenyl]benzonitrile;propane (PubChem CID 168905300) has the molecular formula C20H22BrF3N2O
and a molecular weight of 443.31 g/mol. Its IUPAC name is 6-bromo-2-(dimethylamino)-3-methyl-4-[4-(trifluoromethoxy)phenyl]benzonitrile;propane.
Molecular Properties
| Compound Name | 6-bromo-2-(dimethylamino)-3-methyl-4-[4-(trifluoromethoxy)phenyl]benzonitrile;propane |
| PubChem CID | 168905300 |
| Molecular Formula | C20H22BrF3N2O |
| Molecular Weight | 443.31 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | 6-bromo-2-(dimethylamino)-3-methyl-4-[4-(trifluoromethoxy)phenyl]benzonitrile;propane |
| SMILES | CCC.Cc1c(-c2ccc(OC(F)(F)F)cc2)cc(Br)c(C#N)c1N(C)C |
| InChI | InChI=1S/C17H14BrF3N2O.C3H8/c1-10-13(8-15(18)14(9-22)16(10)23(2)3)11-4-6-12(7-5-11)24-17(19,20)21;1-3-2/h4-8H,1-3H3;3H2,1-2H3 |
| InChIKey | HJSXCWVYWPTLHF-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 443.31 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-bromo-2-(dimethylamino)-3-methyl-4-[4-(trifluoromethoxy)phenyl]benzonitrile;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-2-(dimethylamino)-3-methyl-4-[4-(trifluoromethoxy)phenyl]benzonitrile;propane?
The IUPAC name of 6-bromo-2-(dimethylamino)-3-methyl-4-[4-(trifluoromethoxy)phenyl]benzonitrile;propane (CID 168905300) is 6-bromo-2-(dimethylamino)-3-methyl-4-[4-(trifluoromethoxy)phenyl]benzonitrile;propane.
What is the SMILES notation for 6-bromo-2-(dimethylamino)-3-methyl-4-[4-(trifluoromethoxy)phenyl]benzonitrile;propane?
The canonical SMILES for 6-bromo-2-(dimethylamino)-3-methyl-4-[4-(trifluoromethoxy)phenyl]benzonitrile;propane is CCC.Cc1c(-c2ccc(OC(F)(F)F)cc2)cc(Br)c(C#N)c1N(C)C.
What is the InChIKey of 6-bromo-2-(dimethylamino)-3-methyl-4-[4-(trifluoromethoxy)phenyl]benzonitrile;propane?
The InChIKey is HJSXCWVYWPTLHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14BrF3N2O.C3H8/c1-10-13(8-15(18)14(9-22)16(10)23(2)3)11-4-6-12(7-5-11)24-17(19,20)21;1-3-2/h4-8H,1-3H3;3H2,1-2H3.
What are the key properties of 6-bromo-2-(dimethylamino)-3-methyl-4-[4-(trifluoromethoxy)phenyl]benzonitrile;propane?
6-bromo-2-(dimethylamino)-3-methyl-4-[4-(trifluoromethoxy)phenyl]benzonitrile;propane has a molecular weight of 443.31 g/mol, XLogP of 6.68, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-2-(dimethylamino)-3-methyl-4-[4-(trifluoromethoxy)phenyl]benzonitrile;propane is sourced from PubChem (CID 168905300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).