C22H25F2NO — CID 168905310
5-[4-(1,1-difluoroethyl)phenyl]-2-ethenyl-4-methyl-3-[(E)-2-methylbut-1-enoxy]aniline (PubChem CID 168905310) has the molecular formula C22H25F2NO and a molecular weight of 357.44 g/mol. Its IUPAC name is 5-[4-(1,1-difluoroethyl)phenyl]-2-ethenyl-4-methyl-3-[(E)-2-methylbut-1-enoxy]aniline.
| Compound Name | 5-[4-(1,1-difluoroethyl)phenyl]-2-ethenyl-4-methyl-3-[(E)-2-methylbut-1-enoxy]aniline |
|---|---|
| PubChem CID | 168905310 |
| Molecular Formula | C22H25F2NO |
| Molecular Weight | 357.44 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | 5-[4-(1,1-difluoroethyl)phenyl]-2-ethenyl-4-methyl-3-[(E)-2-methylbut-1-enoxy]aniline |
| SMILES | C=Cc1c(N)cc(-c2ccc(C(C)(F)F)cc2)c(C)c1O/C=C(\C)CC |
| InChI | InChI=1S/C22H25F2NO/c1-6-14(3)13-26-21-15(4)19(12-20(25)18(21)7-2)16-8-10-17(11-9-16)22(5,23)24/h7-13H,2,6,25H2,1,3-5H3/b14-13+ |
| InChIKey | IGPHHCCLSXXOFM-BUHFOSPRSA-N |
| XLogP | 6.69 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.44 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|