C20H22F4N2O — CID 168905635
ethane;5-[2-fluoro-4-(trifluoromethoxy)phenyl]-3-N,4-dimethyl-3-N-prop-1-ynylbenzene-1,3-diamine (PubChem CID 168905635) has the molecular formula C20H22F4N2O and a molecular weight of 382.40 g/mol. Its IUPAC name is ethane;5-[2-fluoro-4-(trifluoromethoxy)phenyl]-3-N,4-dimethyl-3-N-prop-1-ynylbenzene-1,3-diamine.
| Compound Name | ethane;5-[2-fluoro-4-(trifluoromethoxy)phenyl]-3-N,4-dimethyl-3-N-prop-1-ynylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 168905635 |
| Molecular Formula | C20H22F4N2O |
| Molecular Weight | 382.40 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | ethane;5-[2-fluoro-4-(trifluoromethoxy)phenyl]-3-N,4-dimethyl-3-N-prop-1-ynylbenzene-1,3-diamine |
| SMILES | CC.CC#CN(C)c1cc(N)cc(-c2ccc(OC(F)(F)F)cc2F)c1C |
| InChI | InChI=1S/C18H16F4N2O.C2H6/c1-4-7-24(3)17-9-12(23)8-15(11(17)2)14-6-5-13(10-16(14)19)25-18(20,21)22;1-2/h5-6,8-10H,23H2,1-3H3;1-2H3 |
| InChIKey | OGLQBKRUENQWOW-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.40 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|