C24H30F3N5O2S — CID 168906918
7-[(2R,4R,5S)-5-[2-propan-2-yl-5-[5-(trifluoromethyl)-3-pyridinyl]-1,2,4-triazol-3-yl]-2-bicyclo[2.2.1]heptanyl]-2λ6-thia-7-azaspiro[3.4]octane 2,2-dioxide (PubChem CID 168906918) has the molecular formula C24H30F3N5O2S and a molecular weight of 509.60 g/mol. Its IUPAC name is 7-[(2R,4R,5S)-5-[2-propan-2-yl-5-[5-(trifluoromethyl)-3-pyridinyl]-1,2,4-triazol-3-yl]-2-bicyclo[2.2.1]heptanyl]-2λ6-thia-7-azaspiro[3.4]octane 2,2-dioxide.
| Compound Name | 7-[(2R,4R,5S)-5-[2-propan-2-yl-5-[5-(trifluoromethyl)-3-pyridinyl]-1,2,4-triazol-3-yl]-2-bicyclo[2.2.1]heptanyl]-2λ6-thia-7-azaspiro[3.4]octane 2,2-dioxide |
|---|---|
| PubChem CID | 168906918 |
| Molecular Formula | C24H30F3N5O2S |
| Molecular Weight | 509.60 g/mol |
| Exact Mass | 509.21 |
| IUPAC Name | 7-[(2R,4R,5S)-5-[2-propan-2-yl-5-[5-(trifluoromethyl)-3-pyridinyl]-1,2,4-triazol-3-yl]-2-bicyclo[2.2.1]heptanyl]-2λ6-thia-7-azaspiro[3.4]octane 2,2-dioxide |
| SMILES | CC(C)n1nc(-c2cncc(C(F)(F)F)c2)nc1[C@H]1CC2C[C@@H]1C[C@H]2N1CCC2(C1)CS(=O)(=O)C2 |
| InChI | InChI=1S/C24H30F3N5O2S/c1-14(2)32-22(29-21(30-32)17-6-18(10-28-9-17)24(25,26)27)19-7-16-5-15(19)8-20(16)31-4-3-23(11-31)12-35(33,34)13-23/h6,9-10,14-16,19-20H,3-5,7-8,11-13H2,1-2H3/t15-,16?,19+,20-/m1/s1 |
| InChIKey | KBHTZXNGMZGAGS-GAGZNBGBSA-N |
| XLogP | 3.94 |
| TPSA | 80.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.60 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |