About 7-cyclopentyl-2λ6-thia-7-azaspiro[3.4]octane 2,2-dioxide;trifluoromethylbenzene
7-cyclopentyl-2λ6-thia-7-azaspiro[3.4]octane 2,2-dioxide;trifluoromethylbenzene (PubChem CID 168907013) has the molecular formula C18H24F3NO2S
and a molecular weight of 375.46 g/mol. Its IUPAC name is 7-cyclopentyl-2λ6-thia-7-azaspiro[3.4]octane 2,2-dioxide;trifluoromethylbenzene.
Molecular Properties
| Compound Name | 7-cyclopentyl-2λ6-thia-7-azaspiro[3.4]octane 2,2-dioxide;trifluoromethylbenzene |
| PubChem CID | 168907013 |
| Molecular Formula | C18H24F3NO2S |
| Molecular Weight | 375.46 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | 7-cyclopentyl-2λ6-thia-7-azaspiro[3.4]octane 2,2-dioxide;trifluoromethylbenzene |
| SMILES | FC(F)(F)c1ccccc1.O=S1(=O)CC2(CCN(C3CCCC3)C2)C1 |
| InChI | InChI=1S/C11H19NO2S.C7H5F3/c13-15(14)8-11(9-15)5-6-12(7-11)10-3-1-2-4-10;8-7(9,10)6-4-2-1-3-5-6/h10H,1-9H2;1-5H |
| InChIKey | CIPPKSOYGXUWLG-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.46 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-cyclopentyl-2λ6-thia-7-azaspiro[3.4]octane 2,2-dioxide;trifluoromethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-cyclopentyl-2λ6-thia-7-azaspiro[3.4]octane 2,2-dioxide;trifluoromethylbenzene?
The IUPAC name of 7-cyclopentyl-2λ6-thia-7-azaspiro[3.4]octane 2,2-dioxide;trifluoromethylbenzene (CID 168907013) is 7-cyclopentyl-2λ6-thia-7-azaspiro[3.4]octane 2,2-dioxide;trifluoromethylbenzene.
What is the SMILES notation for 7-cyclopentyl-2λ6-thia-7-azaspiro[3.4]octane 2,2-dioxide;trifluoromethylbenzene?
The canonical SMILES for 7-cyclopentyl-2λ6-thia-7-azaspiro[3.4]octane 2,2-dioxide;trifluoromethylbenzene is FC(F)(F)c1ccccc1.O=S1(=O)CC2(CCN(C3CCCC3)C2)C1.
What is the InChIKey of 7-cyclopentyl-2λ6-thia-7-azaspiro[3.4]octane 2,2-dioxide;trifluoromethylbenzene?
The InChIKey is CIPPKSOYGXUWLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO2S.C7H5F3/c13-15(14)8-11(9-15)5-6-12(7-11)10-3-1-2-4-10;8-7(9,10)6-4-2-1-3-5-6/h10H,1-9H2;1-5H.
What are the key properties of 7-cyclopentyl-2λ6-thia-7-azaspiro[3.4]octane 2,2-dioxide;trifluoromethylbenzene?
7-cyclopentyl-2λ6-thia-7-azaspiro[3.4]octane 2,2-dioxide;trifluoromethylbenzene has a molecular weight of 375.46 g/mol, XLogP of 3.75, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-cyclopentyl-2λ6-thia-7-azaspiro[3.4]octane 2,2-dioxide;trifluoromethylbenzene is sourced from PubChem (CID 168907013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).