About 7-[3-(3-chlorophenyl)-2-methylpropyl]-2-thia-7-azaspiro[3.4]octane;cyclohexanol
7-[3-(3-chlorophenyl)-2-methylpropyl]-2-thia-7-azaspiro[3.4]octane;cyclohexanol (PubChem CID 168907393) has the molecular formula C22H34ClNOS
and a molecular weight of 396.04 g/mol. Its IUPAC name is 7-[3-(3-chlorophenyl)-2-methylpropyl]-2-thia-7-azaspiro[3.4]octane;cyclohexanol.
Molecular Properties
| Compound Name | 7-[3-(3-chlorophenyl)-2-methylpropyl]-2-thia-7-azaspiro[3.4]octane;cyclohexanol |
| PubChem CID | 168907393 |
| Molecular Formula | C22H34ClNOS |
| Molecular Weight | 396.04 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | 7-[3-(3-chlorophenyl)-2-methylpropyl]-2-thia-7-azaspiro[3.4]octane;cyclohexanol |
| SMILES | CC(Cc1cccc(Cl)c1)CN1CCC2(CSC2)C1.OC1CCCCC1 |
| InChI | InChI=1S/C16H22ClNS.C6H12O/c1-13(7-14-3-2-4-15(17)8-14)9-18-6-5-16(10-18)11-19-12-16;7-6-4-2-1-3-5-6/h2-4,8,13H,5-7,9-12H2,1H3;6-7H,1-5H2 |
| InChIKey | UYZHHIFSQKANQA-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.04 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-[3-(3-chlorophenyl)-2-methylpropyl]-2-thia-7-azaspiro[3.4]octane;cyclohexanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[3-(3-chlorophenyl)-2-methylpropyl]-2-thia-7-azaspiro[3.4]octane;cyclohexanol?
The IUPAC name of 7-[3-(3-chlorophenyl)-2-methylpropyl]-2-thia-7-azaspiro[3.4]octane;cyclohexanol (CID 168907393) is 7-[3-(3-chlorophenyl)-2-methylpropyl]-2-thia-7-azaspiro[3.4]octane;cyclohexanol.
What is the SMILES notation for 7-[3-(3-chlorophenyl)-2-methylpropyl]-2-thia-7-azaspiro[3.4]octane;cyclohexanol?
The canonical SMILES for 7-[3-(3-chlorophenyl)-2-methylpropyl]-2-thia-7-azaspiro[3.4]octane;cyclohexanol is CC(Cc1cccc(Cl)c1)CN1CCC2(CSC2)C1.OC1CCCCC1.
What is the InChIKey of 7-[3-(3-chlorophenyl)-2-methylpropyl]-2-thia-7-azaspiro[3.4]octane;cyclohexanol?
The InChIKey is UYZHHIFSQKANQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22ClNS.C6H12O/c1-13(7-14-3-2-4-15(17)8-14)9-18-6-5-16(10-18)11-19-12-16;7-6-4-2-1-3-5-6/h2-4,8,13H,5-7,9-12H2,1H3;6-7H,1-5H2.
What are the key properties of 7-[3-(3-chlorophenyl)-2-methylpropyl]-2-thia-7-azaspiro[3.4]octane;cyclohexanol?
7-[3-(3-chlorophenyl)-2-methylpropyl]-2-thia-7-azaspiro[3.4]octane;cyclohexanol has a molecular weight of 396.04 g/mol, XLogP of 5.27, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[3-(3-chlorophenyl)-2-methylpropyl]-2-thia-7-azaspiro[3.4]octane;cyclohexanol is sourced from PubChem (CID 168907393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).