About ethyl (2R)-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]propanoate
ethyl (2R)-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]propanoate (PubChem CID 168907407) has the molecular formula C11H15F3N2O2
and a molecular weight of 264.25 g/mol. Its IUPAC name is ethyl (2R)-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]propanoate.
Molecular Properties
| Compound Name | ethyl (2R)-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]propanoate |
| PubChem CID | 168907407 |
| Molecular Formula | C11H15F3N2O2 |
| Molecular Weight | 264.25 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | ethyl (2R)-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]propanoate |
| SMILES | CCOC(=O)[C@H](C)Cc1cnn(CC(F)(F)F)c1 |
| InChI | InChI=1S/C11H15F3N2O2/c1-3-18-10(17)8(2)4-9-5-15-16(6-9)7-11(12,13)14/h5-6,8H,3-4,7H2,1-2H3/t8-/m1/s1 |
| InChIKey | JWVCXPLHRINQMB-MRVPVSSYSA-N |
| XLogP | 2.19 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.25 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl (2R)-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2R)-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]propanoate?
The IUPAC name of ethyl (2R)-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]propanoate (CID 168907407) is ethyl (2R)-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]propanoate.
What is the SMILES notation for ethyl (2R)-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]propanoate?
The canonical SMILES for ethyl (2R)-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]propanoate is CCOC(=O)[C@H](C)Cc1cnn(CC(F)(F)F)c1.
What is the InChIKey of ethyl (2R)-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]propanoate?
The InChIKey is JWVCXPLHRINQMB-MRVPVSSYSA-N. The full InChI is InChI=1S/C11H15F3N2O2/c1-3-18-10(17)8(2)4-9-5-15-16(6-9)7-11(12,13)14/h5-6,8H,3-4,7H2,1-2H3/t8-/m1/s1.
What are the key properties of ethyl (2R)-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]propanoate?
ethyl (2R)-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]propanoate has a molecular weight of 264.25 g/mol, XLogP of 2.19, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2R)-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]propanoate is sourced from PubChem (CID 168907407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).