C19H27F3N2O2S — CID 168907456
N-[(Z)-2-[3-(2,2-dioxo-2λ6-thia-7-azaspiro[3.5]nonan-7-yl)-2-methylpropyl]pent-1-en-3-ynyl]-1,1,1-trifluoropropan-2-imine (PubChem CID 168907456) has the molecular formula C19H27F3N2O2S and a molecular weight of 404.50 g/mol. Its IUPAC name is N-[(Z)-2-[3-(2,2-dioxo-2λ6-thia-7-azaspiro[3.5]nonan-7-yl)-2-methylpropyl]pent-1-en-3-ynyl]-1,1,1-trifluoropropan-2-imine.
| Compound Name | N-[(Z)-2-[3-(2,2-dioxo-2λ6-thia-7-azaspiro[3.5]nonan-7-yl)-2-methylpropyl]pent-1-en-3-ynyl]-1,1,1-trifluoropropan-2-imine |
|---|---|
| PubChem CID | 168907456 |
| Molecular Formula | C19H27F3N2O2S |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | N-[(Z)-2-[3-(2,2-dioxo-2λ6-thia-7-azaspiro[3.5]nonan-7-yl)-2-methylpropyl]pent-1-en-3-ynyl]-1,1,1-trifluoropropan-2-imine |
| SMILES | CC#C/C(=C\N=C(/C)C(F)(F)F)CC(C)CN1CCC2(CC1)CS(=O)(=O)C2 |
| InChI | InChI=1S/C19H27F3N2O2S/c1-4-5-17(11-23-16(3)19(20,21)22)10-15(2)12-24-8-6-18(7-9-24)13-27(25,26)14-18/h11,15H,6-10,12-14H2,1-3H3/b17-11+,23-16+ |
| InChIKey | KGHWAOJOUPPUJJ-BLXMPMGZSA-N |
| XLogP | 3.45 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|