About 7-[3-[3-chloro-4-(4,4-difluorocyclohexyl)phenyl]propyl]-2-thia-7-azaspiro[3.4]octane
7-[3-[3-chloro-4-(4,4-difluorocyclohexyl)phenyl]propyl]-2-thia-7-azaspiro[3.4]octane (PubChem CID 168907492) has the molecular formula C21H28ClF2NS
and a molecular weight of 399.98 g/mol. Its IUPAC name is 7-[3-[3-chloro-4-(4,4-difluorocyclohexyl)phenyl]propyl]-2-thia-7-azaspiro[3.4]octane.
Molecular Properties
| Compound Name | 7-[3-[3-chloro-4-(4,4-difluorocyclohexyl)phenyl]propyl]-2-thia-7-azaspiro[3.4]octane |
| PubChem CID | 168907492 |
| Molecular Formula | C21H28ClF2NS |
| Molecular Weight | 399.98 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | 7-[3-[3-chloro-4-(4,4-difluorocyclohexyl)phenyl]propyl]-2-thia-7-azaspiro[3.4]octane |
| SMILES | FC1(F)CCC(c2ccc(CCCN3CCC4(CSC4)C3)cc2Cl)CC1 |
| InChI | InChI=1S/C21H28ClF2NS/c22-19-12-16(2-1-10-25-11-9-20(13-25)14-26-15-20)3-4-18(19)17-5-7-21(23,24)8-6-17/h3-4,12,17H,1-2,5-11,13-15H2 |
| InChIKey | GNFXVGCKCJKOTK-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 399.98 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-[3-[3-chloro-4-(4,4-difluorocyclohexyl)phenyl]propyl]-2-thia-7-azaspiro[3.4]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[3-[3-chloro-4-(4,4-difluorocyclohexyl)phenyl]propyl]-2-thia-7-azaspiro[3.4]octane?
The IUPAC name of 7-[3-[3-chloro-4-(4,4-difluorocyclohexyl)phenyl]propyl]-2-thia-7-azaspiro[3.4]octane (CID 168907492) is 7-[3-[3-chloro-4-(4,4-difluorocyclohexyl)phenyl]propyl]-2-thia-7-azaspiro[3.4]octane.
What is the SMILES notation for 7-[3-[3-chloro-4-(4,4-difluorocyclohexyl)phenyl]propyl]-2-thia-7-azaspiro[3.4]octane?
The canonical SMILES for 7-[3-[3-chloro-4-(4,4-difluorocyclohexyl)phenyl]propyl]-2-thia-7-azaspiro[3.4]octane is FC1(F)CCC(c2ccc(CCCN3CCC4(CSC4)C3)cc2Cl)CC1.
What is the InChIKey of 7-[3-[3-chloro-4-(4,4-difluorocyclohexyl)phenyl]propyl]-2-thia-7-azaspiro[3.4]octane?
The InChIKey is GNFXVGCKCJKOTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H28ClF2NS/c22-19-12-16(2-1-10-25-11-9-20(13-25)14-26-15-20)3-4-18(19)17-5-7-21(23,24)8-6-17/h3-4,12,17H,1-2,5-11,13-15H2.
What are the key properties of 7-[3-[3-chloro-4-(4,4-difluorocyclohexyl)phenyl]propyl]-2-thia-7-azaspiro[3.4]octane?
7-[3-[3-chloro-4-(4,4-difluorocyclohexyl)phenyl]propyl]-2-thia-7-azaspiro[3.4]octane has a molecular weight of 399.98 g/mol, XLogP of 6.00, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[3-[3-chloro-4-(4,4-difluorocyclohexyl)phenyl]propyl]-2-thia-7-azaspiro[3.4]octane is sourced from PubChem (CID 168907492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).