C14H19F3O2 — CID 168907567
2-methyl-2-[(3E,5E)-6-(trifluoromethyl)nona-1,3,5-trien-3-yl]oxypropanal (PubChem CID 168907567) has the molecular formula C14H19F3O2 and a molecular weight of 276.30 g/mol. Its IUPAC name is 2-methyl-2-[(3E,5E)-6-(trifluoromethyl)nona-1,3,5-trien-3-yl]oxypropanal.
| Compound Name | 2-methyl-2-[(3E,5E)-6-(trifluoromethyl)nona-1,3,5-trien-3-yl]oxypropanal |
|---|---|
| PubChem CID | 168907567 |
| Molecular Formula | C14H19F3O2 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | 2-methyl-2-[(3E,5E)-6-(trifluoromethyl)nona-1,3,5-trien-3-yl]oxypropanal |
| SMILES | C=C/C(=C\C=C(/CCC)C(F)(F)F)OC(C)(C)C=O |
| InChI | InChI=1S/C14H19F3O2/c1-5-7-11(14(15,16)17)8-9-12(6-2)19-13(3,4)10-18/h6,8-10H,2,5,7H2,1,3-4H3/b11-8+,12-9+ |
| InChIKey | XPEDULJTTYKXDW-HZOWPXDZSA-N |
| XLogP | 4.34 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|