About ethyl (E)-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]prop-2-enoate
ethyl (E)-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]prop-2-enoate (PubChem CID 168907662) has the molecular formula C11H13F3N2O2
and a molecular weight of 262.23 g/mol. Its IUPAC name is ethyl (E)-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]prop-2-enoate.
Molecular Properties
| Compound Name | ethyl (E)-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]prop-2-enoate |
| PubChem CID | 168907662 |
| Molecular Formula | C11H13F3N2O2 |
| Molecular Weight | 262.23 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | ethyl (E)-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C(C)=C/c1cnn(CC(F)(F)F)c1 |
| InChI | InChI=1S/C11H13F3N2O2/c1-3-18-10(17)8(2)4-9-5-15-16(6-9)7-11(12,13)14/h4-6H,3,7H2,1-2H3/b8-4+ |
| InChIKey | VVMIRPZRDYTPSF-XBXARRHUSA-N |
| XLogP | 2.41 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.23 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl (E)-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (E)-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]prop-2-enoate?
The IUPAC name of ethyl (E)-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]prop-2-enoate (CID 168907662) is ethyl (E)-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]prop-2-enoate.
What is the SMILES notation for ethyl (E)-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]prop-2-enoate?
The canonical SMILES for ethyl (E)-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]prop-2-enoate is CCOC(=O)/C(C)=C/c1cnn(CC(F)(F)F)c1.
What is the InChIKey of ethyl (E)-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]prop-2-enoate?
The InChIKey is VVMIRPZRDYTPSF-XBXARRHUSA-N. The full InChI is InChI=1S/C11H13F3N2O2/c1-3-18-10(17)8(2)4-9-5-15-16(6-9)7-11(12,13)14/h4-6H,3,7H2,1-2H3/b8-4+.
What are the key properties of ethyl (E)-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]prop-2-enoate?
ethyl (E)-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]prop-2-enoate has a molecular weight of 262.23 g/mol, XLogP of 2.41, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (E)-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]prop-2-enoate is sourced from PubChem (CID 168907662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).