About 7-[2-[[2-methyl-6-(trifluoromethyl)-3-pyridinyl]oxy]ethyl]-2λ4-thia-7-azaspiro[3.5]nonane 2-oxide
7-[2-[[2-methyl-6-(trifluoromethyl)-3-pyridinyl]oxy]ethyl]-2λ4-thia-7-azaspiro[3.5]nonane 2-oxide (PubChem CID 168907757) has the molecular formula C16H21F3N2O2S
and a molecular weight of 362.42 g/mol. Its IUPAC name is 7-[2-[[2-methyl-6-(trifluoromethyl)-3-pyridinyl]oxy]ethyl]-2λ4-thia-7-azaspiro[3.5]nonane 2-oxide.
Molecular Properties
| Compound Name | 7-[2-[[2-methyl-6-(trifluoromethyl)-3-pyridinyl]oxy]ethyl]-2λ4-thia-7-azaspiro[3.5]nonane 2-oxide |
| PubChem CID | 168907757 |
| Molecular Formula | C16H21F3N2O2S |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | 7-[2-[[2-methyl-6-(trifluoromethyl)-3-pyridinyl]oxy]ethyl]-2λ4-thia-7-azaspiro[3.5]nonane 2-oxide |
| SMILES | Cc1nc(C(F)(F)F)ccc1OCCN1CCC2(CC1)CS(=O)C2 |
| InChI | InChI=1S/C16H21F3N2O2S/c1-12-13(2-3-14(20-12)16(17,18)19)23-9-8-21-6-4-15(5-7-21)10-24(22)11-15/h2-3H,4-11H2,1H3 |
| InChIKey | YSSIELZRJUWJHL-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-[2-[[2-methyl-6-(trifluoromethyl)-3-pyridinyl]oxy]ethyl]-2λ4-thia-7-azaspiro[3.5]nonane 2-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[2-[[2-methyl-6-(trifluoromethyl)-3-pyridinyl]oxy]ethyl]-2λ4-thia-7-azaspiro[3.5]nonane 2-oxide?
The IUPAC name of 7-[2-[[2-methyl-6-(trifluoromethyl)-3-pyridinyl]oxy]ethyl]-2λ4-thia-7-azaspiro[3.5]nonane 2-oxide (CID 168907757) is 7-[2-[[2-methyl-6-(trifluoromethyl)-3-pyridinyl]oxy]ethyl]-2λ4-thia-7-azaspiro[3.5]nonane 2-oxide.
What is the SMILES notation for 7-[2-[[2-methyl-6-(trifluoromethyl)-3-pyridinyl]oxy]ethyl]-2λ4-thia-7-azaspiro[3.5]nonane 2-oxide?
The canonical SMILES for 7-[2-[[2-methyl-6-(trifluoromethyl)-3-pyridinyl]oxy]ethyl]-2λ4-thia-7-azaspiro[3.5]nonane 2-oxide is Cc1nc(C(F)(F)F)ccc1OCCN1CCC2(CC1)CS(=O)C2.
What is the InChIKey of 7-[2-[[2-methyl-6-(trifluoromethyl)-3-pyridinyl]oxy]ethyl]-2λ4-thia-7-azaspiro[3.5]nonane 2-oxide?
The InChIKey is YSSIELZRJUWJHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21F3N2O2S/c1-12-13(2-3-14(20-12)16(17,18)19)23-9-8-21-6-4-15(5-7-21)10-24(22)11-15/h2-3H,4-11H2,1H3.
What are the key properties of 7-[2-[[2-methyl-6-(trifluoromethyl)-3-pyridinyl]oxy]ethyl]-2λ4-thia-7-azaspiro[3.5]nonane 2-oxide?
7-[2-[[2-methyl-6-(trifluoromethyl)-3-pyridinyl]oxy]ethyl]-2λ4-thia-7-azaspiro[3.5]nonane 2-oxide has a molecular weight of 362.42 g/mol, XLogP of 2.63, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[2-[[2-methyl-6-(trifluoromethyl)-3-pyridinyl]oxy]ethyl]-2λ4-thia-7-azaspiro[3.5]nonane 2-oxide is sourced from PubChem (CID 168907757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).