C27H13Cl2N3O2 — CID 168908527
2,4-dichloro-6-(6-dibenzofuran-2-yldibenzofuran-2-yl)-1,3,5-triazine (PubChem CID 168908527) has the molecular formula C27H13Cl2N3O2 and a molecular weight of 482.33 g/mol. Its IUPAC name is 2,4-dichloro-6-(6-dibenzofuran-2-yldibenzofuran-2-yl)-1,3,5-triazine.
| Compound Name | 2,4-dichloro-6-(6-dibenzofuran-2-yldibenzofuran-2-yl)-1,3,5-triazine |
|---|---|
| PubChem CID | 168908527 |
| Molecular Formula | C27H13Cl2N3O2 |
| Molecular Weight | 482.33 g/mol |
| Exact Mass | 481.04 |
| IUPAC Name | 2,4-dichloro-6-(6-dibenzofuran-2-yldibenzofuran-2-yl)-1,3,5-triazine |
| SMILES | Clc1nc(Cl)nc(-c2ccc3oc4c(-c5ccc6oc7ccccc7c6c5)cccc4c3c2)n1 |
| InChI | InChI=1S/C27H13Cl2N3O2/c28-26-30-25(31-27(29)32-26)15-9-11-23-20(13-15)18-6-3-5-16(24(18)34-23)14-8-10-22-19(12-14)17-4-1-2-7-21(17)33-22/h1-13H |
| InChIKey | RGASCJNUUIZNDW-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 64.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.33 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |