C15H11ClF3N5O3 — CID 168909081
5-[2-chloro-5-(trifluoromethoxy)phenyl]-N-(1-cyanopyrrolidin-3-yl)-1,3,4-oxadiazole-2-carboxamide (PubChem CID 168909081) has the molecular formula C15H11ClF3N5O3 and a molecular weight of 401.73 g/mol. Its IUPAC name is 5-[2-chloro-5-(trifluoromethoxy)phenyl]-N-(1-cyanopyrrolidin-3-yl)-1,3,4-oxadiazole-2-carboxamide.
| Compound Name | 5-[2-chloro-5-(trifluoromethoxy)phenyl]-N-(1-cyanopyrrolidin-3-yl)-1,3,4-oxadiazole-2-carboxamide |
|---|---|
| PubChem CID | 168909081 |
| Molecular Formula | C15H11ClF3N5O3 |
| Molecular Weight | 401.73 g/mol |
| Exact Mass | 401.05 |
| IUPAC Name | 5-[2-chloro-5-(trifluoromethoxy)phenyl]-N-(1-cyanopyrrolidin-3-yl)-1,3,4-oxadiazole-2-carboxamide |
| SMILES | N#CN1CCC(NC(=O)c2nnc(-c3cc(OC(F)(F)F)ccc3Cl)o2)C1 |
| InChI | InChI=1S/C15H11ClF3N5O3/c16-11-2-1-9(27-15(17,18)19)5-10(11)13-22-23-14(26-13)12(25)21-8-3-4-24(6-8)7-20/h1-2,5,8H,3-4,6H2,(H,21,25) |
| InChIKey | PXSXVSLNQUOVEB-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 104.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.73 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|