C19H15F4N7O3 — CID 168909358
N-[(3R,5S)-1-cyano-5-(triazol-1-ylmethyl)pyrrolidin-3-yl]-5-[4-fluoro-3-(trifluoromethoxy)phenyl]-1,3-oxazole-2-carboxamide (PubChem CID 168909358) has the molecular formula C19H15F4N7O3 and a molecular weight of 465.37 g/mol. Its IUPAC name is N-[(3R,5S)-1-cyano-5-(triazol-1-ylmethyl)pyrrolidin-3-yl]-5-[4-fluoro-3-(trifluoromethoxy)phenyl]-1,3-oxazole-2-carboxamide.
| Compound Name | N-[(3R,5S)-1-cyano-5-(triazol-1-ylmethyl)pyrrolidin-3-yl]-5-[4-fluoro-3-(trifluoromethoxy)phenyl]-1,3-oxazole-2-carboxamide |
|---|---|
| PubChem CID | 168909358 |
| Molecular Formula | C19H15F4N7O3 |
| Molecular Weight | 465.37 g/mol |
| Exact Mass | 465.12 |
| IUPAC Name | N-[(3R,5S)-1-cyano-5-(triazol-1-ylmethyl)pyrrolidin-3-yl]-5-[4-fluoro-3-(trifluoromethoxy)phenyl]-1,3-oxazole-2-carboxamide |
| SMILES | N#CN1C[C@H](NC(=O)c2ncc(-c3ccc(F)c(OC(F)(F)F)c3)o2)C[C@H]1Cn1ccnn1 |
| InChI | InChI=1S/C19H15F4N7O3/c20-14-2-1-11(5-15(14)33-19(21,22)23)16-7-25-18(32-16)17(31)27-12-6-13(29(8-12)10-24)9-30-4-3-26-28-30/h1-5,7,12-13H,6,8-9H2,(H,27,31)/t12-,13+/m1/s1 |
| InChIKey | KQXBECHSKMWHCO-OLZOCXBDSA-N |
| XLogP | 2.32 |
| TPSA | 122.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.37 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|