C18H21F3N8O3 — CID 168909375
(Z)-2-[amino(methyl)amino]ethenamine;N-(1-cyanopyrrolidin-3-yl)-5-[3-(trifluoromethoxy)phenyl]-1,3,4-oxadiazole-2-carboxamide (PubChem CID 168909375) has the molecular formula C18H21F3N8O3 and a molecular weight of 454.41 g/mol. Its IUPAC name is (Z)-2-[amino(methyl)amino]ethenamine;N-(1-cyanopyrrolidin-3-yl)-5-[3-(trifluoromethoxy)phenyl]-1,3,4-oxadiazole-2-carboxamide.
| Compound Name | (Z)-2-[amino(methyl)amino]ethenamine;N-(1-cyanopyrrolidin-3-yl)-5-[3-(trifluoromethoxy)phenyl]-1,3,4-oxadiazole-2-carboxamide |
|---|---|
| PubChem CID | 168909375 |
| Molecular Formula | C18H21F3N8O3 |
| Molecular Weight | 454.41 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | (Z)-2-[amino(methyl)amino]ethenamine;N-(1-cyanopyrrolidin-3-yl)-5-[3-(trifluoromethoxy)phenyl]-1,3,4-oxadiazole-2-carboxamide |
| SMILES | CN(N)/C=C\N.N#CN1CCC(NC(=O)c2nnc(-c3cccc(OC(F)(F)F)c3)o2)C1 |
| InChI | InChI=1S/C15H12F3N5O3.C3H9N3/c16-15(17,18)26-11-3-1-2-9(6-11)13-21-22-14(25-13)12(24)20-10-4-5-23(7-10)8-19;1-6(5)3-2-4/h1-3,6,10H,4-5,7H2,(H,20,24);2-3H,4-5H2,1H3/b;3-2- |
| InChIKey | APCBNZQLROKVSP-AHNKWOMYSA-N |
| XLogP | 1.14 |
| TPSA | 159.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.41 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|